Climazolam
{{Short description|Anesthetic drug}}
{{Drugbox
| IUPAC_name = 8-Chloro-6-(2-chlorophenyl)-1-methyl-4H-imidazo[1,5-a][1,4]benzodiazepine
| image = Climazolam.svg
| width = 160
| tradename = Climasol
| Drugs.com = {{drugs.com|international|climazolam}}
| legal_CA = Schedule IV
| legal_status =
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 59467-77-5
| ATCvet = yes
| ATC_prefix = N05
| ATC_suffix = CD90
| PubChem = 68790
| ChemSpiderID = 62030
| ChEMBL = 2104070
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = O9KZB9HG1Y
| KEGG = D07714
| C=18 | H=13 | Cl=2 | N=3
| smiles = ClC1=CC=CC=C1C2=NCC3=CN=C(C)N3C4=C2C=C(C=C4)Cl
}}
Climazolam{{cite patent | country = US | number = 4280957 | title = Imidazodiazepines and processes therefor | inventor = Walser A, Fryer RI | assign1 = Hoffman La Roche | gdate = 28 July 1981 }} (Ro21-3982) was introduced under licence as a veterinary medicine by the Swiss Pharmaceutical company Gräub under the tradename Climasol.{{cite web | title = Climazolam | url = https://www.drugs.com/international/climazolam.html | work = Drugs.com | access-date = 2018-01-23 | archive-date = 2017-08-01 | archive-url = https://web.archive.org/web/20170801032200/https://www.drugs.com/international/climazolam.html | url-status = dead }} Climazolam is a benzodiazepine, specifically an imidazobenzodiazepine derivative developed by Hoffman-LaRoche. It is similar in structure to midazolam and diclazepam and is used in veterinary medicine for anesthetizing animals.{{cite journal | vauthors = Ganter M, Kanngiesser M | title = Effect of ketamine and its combinations with xylazine and climazolam on the circulation and respiration in swine | language = German | journal = Zentralbl Veterinarmed A | date = Aug 1991| volume = 38 | issue = 7 | pages = 501–509 | doi = 10.1111/j.1439-0442.1991.tb01041.x | pmid=1950241}}{{cite journal | vauthors = Bettschart-Wolfensberger R, Taylor PM, Sear JW, Bloomfield MR, Rentsch K, Dawling S | title = Physiologic effects of anesthesia induced and maintained by intravenous administration of a climazolam-ketamine combination in ponies premedicated with acepromazine and xylazine | journal = American Journal of Veterinary Research | date = Oct 1996 | volume = 57 | issue = 10 | pages = 1472–1477 | pmid= 8896687}}
References
{{reflist}}
{{Benzodiazepines}}
{{GABAAR PAMs}}
Category:2-Chlorophenyl compounds
Category:GABAA receptor positive allosteric modulators
Category:Imidazobenzodiazepines
{{sedative-stub}}