Cymarin

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 448828501

| IUPAC_name = (3S,5S,8R,10S,13R,14S,17R)-5,14-dihydroxy-3-((2R,4S,5S,6R)-5-hydroxy-4-methoxy-6-methyltetrahydro-2H-pyran-2-yloxy)-13-methyl-17-(5-oxo-2,5-dihydrofuran-3-yl)hexadecahydro-1H-cyclopenta[a]phenanthrene-10-carbaldehyde

| image = Cymarine.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 508-77-0

| ATC_prefix = C01

| ATC_suffix = AC03

| PubChem = 441853

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 390429

| smiles = O=C\1OC/C(=C/1)[C@H]2CC[C@@]6(O)[C@]2(C)CC[C@H]4[C@H]6CC[C@]5(O)C[C@@H](O[C@@H]3O[C@@H]([C@@H](O)[C@@H](OC)C3)C)CC[C@]45C=O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C30H44O9/c1-17-26(33)23(36-3)13-25(38-17)39-19-4-9-28(16-31)21-5-8-27(2)20(18-12-24(32)37-15-18)7-11-30(27,35)22(21)6-10-29(28,34)14-19/h12,16-17,19-23,25-26,33-35H,4-11,13-15H2,1-3H3/t17-,19+,20-,21+,22-,23+,25+,26-,27-,28+,29+,30+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = XQCGNURMLWFQJR-ZNDDOCHDSA-N

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = UK3LS8435E

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1651908

| C=30 | H=44 | O=9

| synonyms = Cymarine; K-Strophanthin-α; NSC 7522; Strophantin K; WV 90043a; k-Strophanthin-α

| melting_point = 148

}}

Cymarin (or cymarine) is a cardiac glycoside. Plants of the genus Apocynum, including Apocynum cannabinum and Apocynum venetum, contain cymarin.{{cite book | title = Edible and Medicinal plants of the West | vauthors = Tilford GL | isbn = 0-87842-359-1}} Cymarin is a cardiac glycoside and an anti-arrhythmia and cardiotonic agent.{{PubChem|441853}}