DALT

{{cs1 config|name-list-format=vanc|display-authors=6}}

{{short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 451559106

| image = DALT-structure.png

| width =

| tradename =

| pregnancy_category =

| routes_of_administration = Oral, intramuscular injection

| class = Serotonin receptor modulator; Serotonergic psychedelic; Hallucinogen

| ATC_prefix = None

| ATC_suffix =

| legal_DE = NpSG

| legal_UK = Class A

| legal_US = Analogue

| legal_US_comment = (possibly)

| legal_UN = Unscheduled but not approved for human consumption.

| legal_status = in theory could be covered under similar analogue bills in other countries but this is not confirmed.

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 60676-77-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 85113MO9BC

| PubChem = 24839550

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 21250454

| synonyms = N,N-Diallyltryptamine; DALT; DAT

| IUPAC_name = N-Allyl-N-[2-(1H-indol-3-yl)ethyl]prop-2-en-1-amine

| C=16 | H=20 | N=2

| SMILES = C=CCN(CC=C)CCc2c[nH]c1ccccc12

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C16H20N2/c1-3-10-18(11-4-2)12-9-14-13-17-16-8-6-5-7-15(14)16/h3-8,13,17H,1-2,9-12H2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = LQEATNFJCMVKAC-UHFFFAOYSA-N

}}

N,N-Diallyltryptamine (DALT) is a tryptamine derivative which has been identified as a new psychoactive substance.{{cite journal | vauthors = Michely JA, Helfer AG, Brandt SD, Meyer MR, Maurer HH | title = Metabolism of the new psychoactive substances N,N-diallyltryptamine (DALT) and 5-methoxy-DALT and their detectability in urine by GC-MS, LC-MSn, and LC-HR-MS-MS | journal = Analytical and Bioanalytical Chemistry | volume = 407 | issue = 25 | pages = 7831–42 | date = October 2015 | pmid = 26297461 | doi = 10.1007/s00216-015-8955-0 | s2cid = 26086597 | url = http://researchonline.ljmu.ac.uk/id/eprint/3406/1/ABC-01148-2015.R1.pdf }}{{cite journal | vauthors = Michely JA, Brandt SD, Meyer MR, Maurer HH | title = n, and LC-HR-MS/MS | journal = Analytical and Bioanalytical Chemistry | volume = 409 | issue = 6 | pages = 1681–1695 | date = February 2017 | pmid = 27933361 | doi = 10.1007/s00216-016-0117-5 | s2cid = 206920201 | url = http://researchonline.ljmu.ac.uk/id/eprint/4885/1/ABC_5F_7Me_5%2C6MD-DALT_accepted.pdf }} It has been used as an intermediate in the preparation of radiolabeled diethyltryptamine.{{cite journal | vauthors = Brandt SD, Tirunarayanapuram SS, Freeman S, Dempster N, Barker SA, Daley PF, Cozzi NV, Martins CP | title = Microwave-accelerated synthesis of psychoactive deuterated N,N-dialkylated-[α,α,β,β-d4]-tryptamines | journal = Journal of Labelled Compounds and Radiopharmaceuticals | date = 2008 | volume = 51 | issue = 14 | pages = 423–429 | doi = 10.1002/jlcr.1557}}