DNQX

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 460112258

| Name =

| ImageFile = DNQX.png

| ImageSize = 180

| ImageAlt = Skeletal formula

| ImageFile1 = DNQX molecule spacefill.png

| ImageSize1 = 180

| ImageAlt1 = Space-filling model of DNQX

| PIN = 6,7-Dinitro-1,4-dihydroquinoxaline-2,3-dione

| OtherNames =

| Section1 = {{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 3123097

| PubChem = 3899541

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL =

| InChI = 1S/C8H4N4O6/c13-7-8(14)10-4-2-6(12(17)18)5(11(15)16)1-3(4)9-7/h1-2H,(H,9,13)(H,10,14)

| InChIKey = RWVIMCIPOAXUDG-UHFFFAOYSA-N

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C8H4N4O6/c13-7-8(14)10-4-2-6(12(17)18)5(11(15)16)1-3(4)9-7/h1-2H,(H,9,13)(H,10,14)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = RWVIMCIPOAXUDG-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|changed|??}}

| CASNo=2379-57-9

| UNII = 62T278S1MX

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB03759

| SMILES = O=c2[nH]c1cc(N(=O)=O)c(N(=O)=O)cc1[nH]c2=O

}}

| Section2 = {{Chembox Properties

| C=8 | H=4 | N=4 | O=6

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

| Section3 = {{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

| Section4 =

| Section5 =

| Section6 =

}}

DNQX (6,7-dinitroquinoxaline-2,3-dione) is a competitive antagonist at AMPA and kainate receptors, two ionotropic glutamate receptor (iGluR) subfamilies.{{cite journal | vauthors = Traynelis SF, Wollmuth LP, McBain CJ, Menniti FS, Vance KM, Ogden KK, Hansen KB, Yuan H, Myers SJ, Dingledine R | display-authors = 6 | title = Glutamate receptor ion channels: structure, regulation, and function | journal = Pharmacological Reviews | volume = 62 | issue = 3 | pages = 405–496 | date = September 2010 | pmid = 20716669 | pmc = 2964903 | doi = 10.1124/pr.109.002451 }} It is used in a variety of molecular biology subfields, notably neurophysiology, to assist researchers in determining the properties of various types of ion channels and their potential applications in medicine.

DNQX (an AMPA receptor antagonist) displays significant effects on neurons. When applied to rat hippocampus neurons in culture, it produces a dose-dependent neurotoxicity which intriguingly seems to operate through a mechanism independent of ionotropic glutamate receptors. This effect is specific to neurons and does not impact the surrounding glial cells.{{cite journal | vauthors = Martin A, Récasens M, Guiramand J | title = DNQX-induced toxicity in cultured rat hippocampal neurons: an apparent AMPA receptor-independent effect? | journal = Neurochemistry International | volume = 42 | issue = 3 | pages = 251–260 | date = February 2003 | doi = 10.1016/s0197-0186(02)00089-x | pmid = 12427479 | s2cid = 20218909 }}

In the context of amphetamine-induced behavioral sensitization in mice, DNQX demonstrates the capacity to block both the onset and the manifestation of this sensitization. Rather than impacting the overall amphetamine activity, DNQX specifically intervenes in the sensitization process. This phenomenon might be attributed to the activation of excitatory amino acid receptors which subsequently provoke an increased dopamine release in the striatum. Therefore, DNQX's actions appear to be both potent and specific hinting at complex mechanisms beyond traditional ionotropic glutamate receptor pathways.{{cite journal | vauthors = Karler R, Calder LD, Turkanis SA | title = DNQX blockade of amphetamine behavioral sensitization | journal = Brain Research | volume = 552 | issue = 2 | pages = 295–300 | date = June 1991 | doi = 10.1016/0006-8993(91)90095-d | pmid = 1913191 | s2cid = 25330860 }}

An activation of both AMPA/kainate and dopaminergic receptors in the nucleus accumbens may be crucial for the reward response triggered by psychostimulant drugs. Dopaminergic antagonists often do not prevent the acquisition of a conditioned place preference for cocaine, a common measure of drug reward. In experiments where DNQX, an AMPA receptor antagonist, was injected into the nucleus accumbens prior to systemic cocaine administration, it diminished the acquisition of this place preference, highlighting AMPA receptors' role in this process. Conversely, the dopaminergic antagonist fluphenazine did not alter cocaine-induced place preference, possibly due to adaptations following repeated drug exposure. Both DNQX and fluphenazine blocked the expression of conditioned place preference in rats previously trained with cocaine alone, indicating the involvement of both AMPA and dopaminergic receptors in the expression of cocaine-induced place preference.{{cite journal | vauthors = Kaddis FG, Uretsky NJ, Wallace LJ | title = DNQX in the nucleus accumbens inhibits cocaine-induced conditioned place preference | journal = Brain Research | volume = 697 | issue = 1–2 | pages = 76–82 | date = October 1995 | doi = 10.1016/0006-8993(95)00786-p | pmid = 8593597 | s2cid = 24779097 }}