Delphinidin

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 414413412

| ImageFile=Delphinidin.svg

| ImageSize=200px

| ImageClass=skin-invert-image

| IUPACName=3,3′,4′,5,5′,7-Hexahydroxyflavylium

| SystematicName=3,5,7-Trihydroxy-2-(3,4,5-trihydroxyphenyl)-1λ⁴-1-benzopyran-1-ylium

| OtherNames=

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 114185

| InChI = 1/C15H10O7.ClH/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6;/h1-5H,(H5-,16,17,18,19,20,21);1H

| InChIKey = FFNDMZIBVDSQFI-UHFFFAOYAW

| SMILES = C1=C(C=C(C(=C1O)O)O)C2=C(C=C3C(=CC(=CC3=[O+]2)O)O)O.[Cl-]

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 28436

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 590878

| ChEMBL2_Ref = {{ebicite|changed|EBI}}

| ChEMBL2 = 276780

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C15H10O7.ClH/c16-7-3-9(17)8-5-12(20)15(22-13(8)4-7)6-1-10(18)14(21)11(19)2-6;/h1-5H,(H5-,16,17,18,19,20,21);1H

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = FFNDMZIBVDSQFI-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=13270-61-6

| CASNo1_Ref = {{cascite|correct|CAS}}

| CASNo1=528-53-0

| CASNo1_Comment = (chloride)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 031A4BN94T

| UNII1_Ref = {{fdacite|correct|FDA}}

| UNII1 = EM6MD4AEHE

| UNII1_Comment = (chloride)

| PubChem = 68245

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C05908

}}

|Section2={{Chembox Properties

| Formula=C₁₅H₁₁O₇⁺

| MolarMass = 303.24 g/mol

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Delphinidin (also delphinidine{{cite web | url = https://www.chemindustry.com/chemicals/0934666.html | title = Delphinidine }}{{cite web | url = http://en.chembase.cn/substance-136982.html | title = Delphinidine }}) is an anthocyanidin, a primary plant pigment, and also an antioxidant.{{cite journal | title = Delphinidin, an Anthocyanidin in Pigmented Fruits and Vegetables, Protects Human HaCaT Keratinocytes and Mouse Skin Against UVB-Mediated Oxidative Stress and Apoptosis |author1=Afaq, F. |author2=Syed, D. N. |author3=Malik, A. |author4=Hadi, N. |author5=Sarfaraz, S. |author6=Kweon, M.-H. |author7=Khan, N. |author8=Zaid, M. A. |author9=Mukhtar, H. | journal = Journal of Investigative Dermatology | year = 2007 | volume = 127 | issue = 1 | pages = 222–232 | doi = 10.1038/sj.jid.5700510 | pmid = 16902416 |doi-access=free }} Delphinidin gives blue hues to flowers in the genera Viola and Delphinium. It also gives the blue-red color of the grape variety Cabernet Sauvignon, and can be found in cranberries and Concord grapes as well as pomegranates,{{ cite journal |author1=Ribéreau-Gayon, J. |author2=Ribéreau-Gayon, P. | title = The Anthocyans and Leucoanthocyans of Grapes and Wines | journal = American Journal of Enology and Viticulture | year = 1958 | volume = 9 | pages = 1–9 }} and bilberries.{{cite journal |journal=J Agric Food Chem|vauthors=Lätti AK, Riihinen KR, Kainulainen PS |title=Analysis of anthocyanin variation in wild populations of bilberry (Vaccinium myrtillus L.) in Finland |year=2008 |volume=56 |issue=1|pages=190–6 |pmid=18072741 |doi=10.1021/jf072857m}}

Delphinidin, like nearly all other anthocyanidins, is pH-sensitive, i.e. a natural pH indicator, and changes from blue in basic solution to red in acidic solution.