Demecarium bromide
{{Short description|Chemical compound}}
{{Distinguish|Decamethonium}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 460775208
| IUPAC_name = Trimethyl-[3-[methyl-[10-[methyl-(3-trimethylammoniophenoxy)carbonyl-amino]decyl]carbamoyl]oxyphenyl]ammonium dibromide
| image = Demecarium bromide.svg
| width = 300
| tradename = Humorsol
| pregnancy_category =
| legal_status =
| routes_of_administration = Topical (ophthalmic solution)
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 56-94-0
| ATC_prefix = S01
| ATC_suffix = EB04
| ATC_supplemental =
| PubChem = 5965
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00944
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5750
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 61D5V4OKTP
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00667
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 4391
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1200514
| C=32 | H=52 | Br=2 | N=4 | O=4
| smiles = [Br-].[Br-].O=C(Oc1cccc(c1)[N+](C)(C)C)N(CCCCCCCCCCN(C(=O)Oc2cccc(c2)[N+](C)(C)C)C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C32H52N4O4.2BrH/c1-33(31(37)39-29-21-17-19-27(25-29)35(3,4)5)23-15-13-11-9-10-12-14-16-24-34(2)32(38)40-30-22-18-20-28(26-30)36(6,7)8;;/h17-22,25-26H,9-16,23-24H2,1-8H3;2*1H/q+2;;/p-2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YHKBUDZECQDYBR-UHFFFAOYSA-L
}}
Demecarium bromide, trade name Humorsol, is a carbamate parasympathomimetic drug that acts as an acetylcholinesterase inhibitor, and is used as a glaucoma medication. It is applied directly to the eye in order to reduce elevated intraocular pressure associated with glaucoma.{{cite book | veditors = Jeske AH |title=Mosby's dental drug reference |date=2014 |publisher=Elsevier Mosby |location=St. Louis, Missouri |isbn=978-0-323-16916-5 |page=374 |edition=11th |chapter-url=https://books.google.com/books?id=OcU0AwAAQBAJ&pg=PR548 |chapter=Demecarium bromide}}
Demecarium causes constriction of the pupil (miosis), which improves the drainage of the fluid in the eye (aqueous humour).{{cite book | vauthors = Stein HA, Stein RM, Freeman M |title=Ophthalmic dictionary and vocabulary builder for eye care professionals |date=2012 |publisher=Jaypee Brothers Medical |location=New Delhi |isbn=9789350253656 |page=103 |edition=4th | chapter = Demecarium bromide (Humorsol) | chapter-url = https://books.google.com/books?id=-xnRmiZBzqwC&pg=PA103}} As demecarium reversibly inhibits cholinesterase, it can be administered less frequently than other parasympathomimetic drugs, such as carbachol.
Commercially produced demecarium bromide solution, previously sold under the trade name Humorsol,{{cite book | vauthors = Edmunds MW, Mayhew MS |title=Pharmacology for the primary care provider |date=2013 |publisher=Elsevier Health Sciences |isbn=978-0-323-08790-2 |page=174 |edition=4th |url=https://books.google.com/books?id=8FwdEsvnw8oC&pg=PA174}} is no longer available,{{cite book | vauthors = Maggs DJ, Miller PE, Ofri R |title=Slatter's Fundamentals of Veterinary Ophthalmology |date=2013 |publisher=Elsevier |location=St. Louis, Missouri |isbn=978-1-4377-2367-0 |page=51 |edition=5th |chapter-url=https://books.google.com/books?id=8QCduRN3zR0C&pg=PA51 |chapter=Indirect-acting parasympathomimetic agents}} although solutions of demecarium can be compounded.{{cite journal | vauthors = Alario AF, Strong TD, Pizzirani S | title = Medical Treatment of Primary Canine Glaucoma | journal = The Veterinary Clinics of North America. Small Animal Practice | volume = 45 | issue = 6 | pages = 1235–59, vi | date = November 2015 | pmid = 26319445 | doi = 10.1016/j.cvsm.2015.06.004 }}
Use in dogs
When administered with a topical corticosteroid, demecarium can delay the onset of primary glaucoma in dogs. High doses of demecarium may cause organophosphate toxicity, particularly if flea treatments containing organophosphates are administered at the same time.
See also
References
{{Reflist|2}}
{{Opthalmologicals}}
{{Acetylcholine metabolism and transport modulators}}
Category:Acetylcholinesterase inhibitors
Category:Bisquaternary anticholinesterases