Deoxyguanosine diphosphate

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447288204

| ImageFile=DGDP chemical structure.png

| ImageSize = 220

| ImageAlt = Skeletal formula of deoxyguanosine diphosphate

| ImageFile1 = Deoxyguanosine-diphosphate-anion-3D-spacefill.png

| ImageAlt1 = Space-filling model of the deoxyguanosine diphosphate anion

| IUPACName=2′-Deoxyguanosine 5′-(trihydrogen diphosphate)

| SystematicName=[(2R,3S,5R)-5-(2-Amino-6-oxo-1,6-dihydro-9H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl trihydrogen diphosphate

| OtherNames= dGDP; 2'-Deoxyguanosine-5'-diphosphate; 2'-Deoxy-GDP; 5'-dGDP

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|changed|??}}

| CASNo = 3493-09-2

| PubChem = 439220

| DrugBank = DB03491

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 388359

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 28862

| SMILES = O=P(O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n1cnc2c1NC(=N/C2=O)\N)C[C@@H]3O

| InChI = 1/C10H15N5O10P2/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(24-6)2-23-27(21,22)25-26(18,19)20/h3-6,16H,1-2H2,(H,21,22)(H2,18,19,20)(H3,11,13,14,17)/t4-,5+,6+/m0/s1

| InChIKey = CIKGWCTVFSRMJU-KVQBGUIXBA

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C10H15N5O10P2/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(24-6)2-23-27(21,22)25-26(18,19)20/h3-6,16H,1-2H2,(H,21,22)(H2,18,19,20)(H3,11,13,14,17)/t4-,5+,6+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = CIKGWCTVFSRMJU-KVQBGUIXSA-N

}}

|Section2={{Chembox Properties

| C = 10 | H = 15 | N = 5 | O = 10 | P = 2

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Deoxyguanosine diphosphate (dGDP) is a nucleoside diphosphate. It is related to the common nucleic acid guanosine triphosphate (GTP), with the -OH group on the 2' carbon on the nucleotide's pentose removed (hence the deoxy- part of the name), and with one fewer phosphoryl group than GTP.{{cite web | url = https://go.drugbank.com/drugs/DB03491 | title = 2'-Deoxyguanosine-5'-Diphosphate | work = DrugBank }}