Deschloroetizolam

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| IUPAC_name = 4-phenyl-2-ethyl-9-methyl-6H-thieno[3,2-f][1,2,4]triazolo[4,3-a][1,4]diazepine

| image = Deschloroetizolam.svg

| image_class = skin-invert-image

| width = 155

| image2 = Deschloroetizolam.png

| image_class2 = bg-transparent

| tradename =

| dependency_liability = Moderate

| routes_of_administration= Oral, sublingual, rectal

| legal_DE = NpSG

| legal_UK = Class C

| legal_status = Illegal in Sweden

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 40054-73-7

| PubChem = 827322

| UNII = 69HF7J354D

| ChemSpiderID = 722596

| C=17 | H=16 | N=4 | S=1

| smiles = CCC1=CC2=C(S1)N3C(=NN=C3CN=C2C4=CC=CC=C4)C

| StdInChI = 1S/C17H16N4S/c1-3-13-9-14-16(12-7-5-4-6-8-12)18-10-15-20-19-11(2)21(15)17(14)22-13/h4-9H,3,10H2,1-2H3

| StdInChIKey = JIOBORXCOGMHSV-UHFFFAOYSA-N

}}

Deschloroetizolam (also known as Etizolam-2) is a thienotriazolodiazepine that is the dechlorinated analog of the closely related etizolam.{{cite journal | vauthors = Weber KH, Bauer A, Langbein A, Daniel H | title=Heteroaromaten mit anellierten Siebenringen, III. Umwandlung von Thienotriazolooxazepinen in Diazepine | journal=Justus Liebigs Annalen der Chemie |date=September 1978 | volume=1978 | issue=8 | pages=1257–1265 | doi=10.1002/jlac.197819780806 | language=German}}{{cite patent | country = US | number = 3904641 | title = Triazolothienodiazepine compounds | inventor = Nakanishi M, Tahara T, Araki K, Shiroki M | pubdate= 1975-09-09 | assign1 = Yoshitomi Pharmaceutical Industries, Ltd. }}{{cite patent | country = EP | number = 0776892 | title = Thienylazole compound and thienotriazolodiazepine compound | inventor = Hiroshi K, Syuji E, Hideaki S, Minoru M, Kenichi O | assign1 = Yoshitomi Pharmaceutical Industries, Ltd. | pubdate = 4 June 1997 }} The compound has been sold as a designer drug.{{cite journal | vauthors = Pettersson Bergstrand M, Helander A, Hansson T, Beck O | title = Detectability of designer benzodiazepines in CEDIA, EMIT II Plus, HEIA, and KIMS II immunochemical screening assays | journal = Drug Testing and Analysis | volume = 9 | issue = 4 | pages = 640–645 | date = April 2017 | pmid = 27366870 | doi = 10.1002/dta.2003 }}{{cite journal | vauthors = Manchester KR, Maskell PD, Waters L | title = Experimental versus theoretical log D_7.4 , pK_a and plasma protein binding values for benzodiazepines appearing as new psychoactive substances | journal = Drug Testing and Analysis | volume = 10 | issue = 8 | pages = 1258–1269 | date = March 2018 | pmid = 29582576 | doi = 10.1002/dta.2387 | s2cid = 31098917 | url = https://rke.abertay.ac.uk/en/publications/527a634d-decc-4d3a-bdca-08659bb13ed6 }}{{cite journal | vauthors = Manchester KR, Waters L, Haider S, Maskell PD | title = The blood-to-plasma ratio and predicted GABA_A-binding affinity of designer benzodiazepines | journal = Forensic Toxicology | volume = 40 | issue = 2 | pages = 349–356 | date = July 2022 | pmid = 36454409 | pmc = 9715504 | doi = 10.1007/s11419-022-00616-y | s2cid = 247455284 }}