Deschloroclotizolam

{{Short description|Designer drug}}

{{Drugbox

| IUPAC_name = 2-chloro-4-phenyl-9-methyl-4H-thieno[3,2-f] [1,2,4]triazolo[4,3-a] [1,4]diazepine

| image = Deschloroclotizolam.svg

| image_class = skin-invert-image

| width = 140

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_CA = Schedule IV

| legal_DE = NpSG

| legal_UK = Schedule 1

| legal_status =

| routes_of_administration =

| addiction_liability =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 1629324-97-5

| ATC_prefix =

| ATC_suffix =

| PubChem = 157010678

| ChemSpiderID =

| UNII = 5UY5T8AK63

| C = 15

| H = 11

| Cl = 1

| N = 4

| S = 1

| melting_point =

| smiles = CC1=NN=C2N1C3=C(C=C(S3)Cl)C(=NC2)C4=CC=CC=C4

| StdInChI = 1S/C15H11ClN4S/c1-9-18-19-13-8-17-14(10-5-3-2-4-6-10)11-7-12(16)21-15(11)20(9)13/h2-7H,8H2,1H3

| StdInChIKey = DBAZIULAFZCKIM-UHFFFAOYSA-N

}}

Deschloroclotizolam is a thienotriazolodiazepine derivative which has been sold as a designer drug, first being identified in Sweden in 2021.{{cite book | url = https://www.emcdda.europa.eu/system/files/publications/14637/20222218_PDF_TD0522113ENN_002.pdf | title = New psychoactive substances: 25 years of early warning and response in Europe. An update from the EU Early Warning System | publisher = European Monitoring Centre for Drugs and Drug Addiction | date = June 2022 | isbn = 978-92-9497-737-3 | doi = 10.2810/882318 | author1 = European Monitoring Centre for Drugs Drug Addiction | doi-broken-date = 1 November 2024 }}