Dexloxiglumide

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 360226032

| IUPAC_name = (4R)-4-[(3,4-dichlorobenzoyl)amino]-5-(3-methoxypropylpentylamino)-5-oxopentanoic acid

| image = Dexloxiglumide v2.svg

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 119817-90-2

| ATC_prefix = none

| ATC_suffix =

| PubChem = 65937

| IUPHAR_ligand = 889

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 69DY40RH9B

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 550781

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 59342

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C21H30Cl2N2O5/c1-3-4-5-11-25(12-6-13-30-2)21(29)18(9-10-19(26)27)24-20(28)15-7-8-16(22)17(23)14-15/h7-8,14,18H,3-6,9-13H2,1-2H3,(H,24,28)(H,26,27)/t18-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = QNQZBKQEIFTHFZ-GOSISDBHSA-N

| C=21 | H=30 | Cl=2 | N=2 | O=5

| smiles = CCCCCN(CCCOC)C(=O)[C@@H](CCC(=O)O)NC(=O)C1=CC(=C(C=C1)Cl)Cl

}}

Dexloxiglumide is a drug which acts as a cholecystokinin antagonist, selective for the CCKA subtype. It inhibits gastrointestinal motility and reduces gastric secretions, and despite older selective CCKA antagonists such as lorglumide and devazepide having had only limited success in trials and ultimately never making it into clinical use, dexloxiglumide is being investigated as a potential treatment for a variety of gastrointestinal problems including irritable bowel syndrome,{{cite journal | vauthors = Cremonini F, Camilleri M, McKinzie S, Carlson P, Camilleri CE, Burton D, Thomforde G, Urrutia R, Zinsmeister AR | display-authors = 6 | title = Effect of CCK-1 antagonist, dexloxiglumide, in female patients with irritable bowel syndrome: a pharmacodynamic and pharmacogenomic study | journal = The American Journal of Gastroenterology | volume = 100 | issue = 3 | pages = 652–63 | date = March 2005 | doi = 10.1111/j.1572-0241.2005.41081.x | pmid = 15743365 | s2cid = 34227592 }} dyspepsia,{{cite journal | vauthors = Galligan JJ, Vanner S | title = Basic and clinical pharmacology of new motility promoting agents | journal = Neurogastroenterology and Motility | volume = 17 | issue = 5 | pages = 643–53 | date = October 2005 | pmid = 16185302 | doi = 10.1111/j.1365-2982.2005.00675.x | s2cid = 7298061 | doi-access = free }} constipation{{cite journal | vauthors = Roberts DJ, Banh HL, Hall RI | title = Use of novel prokinetic agents to facilitate return of gastrointestinal motility in adult critically ill patients | journal = Current Opinion in Critical Care | volume = 12 | issue = 4 | pages = 295–302 | date = August 2006 | pmid = 16810038 | doi = 10.1097/01.ccx.0000235205.54579.5d | s2cid = 32307333 }} and pancreatitis,{{cite journal | vauthors = Maselli MA, Mennuni L | title = CCK1 receptor antagonist, dexloxiglumide: effects on human isolated gallbladder. Potential clinical applications | journal = Minerva Gastroenterologica e Dietologica | volume = 49 | issue = 3 | pages = 211–6 | date = September 2003 | pmid = 16484960 }}{{cite journal | vauthors = Barrett TD, Yan W, Freedman JM, Lagaud GJ, Breitenbucher JG, Shankley NP | title = Role of CCK and potential utility of CCK1 receptor antagonism in the treatment of pancreatitis induced by biliary tract obstruction | journal = British Journal of Pharmacology | volume = 153 | issue = 8 | pages = 1650–8 | date = April 2008 | pmid = 18297100 | pmc = 2438255 | doi = 10.1038/bjp.2008.44 }} and has had moderate success so far although trials are still ongoing.

References