Diallyllysergamide

{{Short description|Chemical compound}}

{{Infobox drug

| Watchedfields = changed

| verifiedrevid = 447574467

| drug_name = Diallyllysergamide

| image = DALAD.svg

| width = 200

| tradename =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US = Analogue

| legal_US_comment = (but only if it is intended for human consumption)

| routes_of_administration = Oral

| metabolism = hepatic

| excretion = renal

| ATC_prefix = none

| CAS_number = 73032-97-0

| PubChem = 57481013

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 21106294

| synonyms = DAL, Lysergic acid diallylamide, d-lysergic acid diallylamide, d-diallyllysergamide

| IUPAC_name = (6aR,9R)-N,N-Diallyl-7-methyl-4,6,6a,7,8,9-hexahydroindolo-[4,3-fg]quinoline-9-carboxamide

| C=22 | H=25 | N=3 | O=1

| smiles = C=CCN(CC=C)C(=O)[C@@H]2C=C1c3cccc4[nH]cc(C[C@H]1N(C)C2)c34

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C22H25N3O/c1-4-9-25(10-5-2)22(26)16-11-18-17-7-6-8-19-21(17)15(13-23-19)12-20(18)24(3)14-16/h4-8,11,13,16,20,23H,1-2,9-10,12,14H2,3H3/t16-,20-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = VAMQYGHNZLRSSA-OXQOHEQNSA-N

}}

N,N-Diallyllysergamide (DAL, as the tartrate salt), also known as lysergic acid diallylamide, is a psychedelic lysergamide related to lysergic acid diethylamide (LSD).{{cite book | vauthors = Nichols DE | title = Chemistry and Structure-Activity Relationships of Psychedelics | veditors = Halberstadt AL, Vollenweider FX, Nichols DE | series = Current Topics in Behavioral Neurosciences| volume = 36 | issue = | pages = 1–43 | date = 2018 | pmid = 28401524 | doi = 10.1007/7854_2017_475 | publisher = Springer | isbn = 978-3-662-55878-2 }} In their book TiHKAL, Alexander and Ann Shulgin describe it as being "an order of magnitude less potent than LSD itself".