Difenamizole
{{Chembox
| ImageFile = Difenamizole.svg
| ImageClass = skin-invert-image
| ImageSize = 200px
| ImageAlt =
| IUPACName = 2-(Dimethylamino)-N-(2,5-diphenylpyrazol-3-yl)propanamide
| OtherNames = Diphenamizole
|Section1={{Chembox Identifiers
| CASNo = 20170-20-1
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 24MR6YLL3W
| PubChem = 65695
| ChemSpiderID = 59123
| ChEMBL = 2105587
| InChI=1S/C20H22N4O/c1-15(23(2)3)20(25)21-19-14-18(16-10-6-4-7-11-16)22-24(19)17-12-8-5-9-13-17/h4-15H,1-3H3,(H,21,25)
| InChIKey= PCXMKBOWWVXEDT-UHFFFAOYSA-N
| SMILES = CC(C(=O)NC1=CC(=NN1C2=CC=CC=C2)C3=CC=CC=C3)N(C)C}}
|Section2={{Chembox Properties
| C=20 | H=22 | N=4 | O=1
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}
Difenamizole (INN; brand name Pasalin; former developmental code name AP-14) is a nonsteroidal anti-inflammatory drug (NSAID) and analgesic of the pyrazolone group related to metamizole.{{cite book|author=J. Elks|title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA398|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=398–}} It has monoaminergic properties, including inhibition of monoamine oxidase, augmentation of pargyline-induced elevation of striatal dopamine levels, inhibition of K+-induced striatal dopamine release, and inhibition of the reuptake of dopamine.{{cite journal|last1=Secci|first1=D.|last2=Bolasco|first2=A.|last3=Chimenti|first3=P.|last4=Carradori|first4=S.|title=The State of the Art of Pyrazole Derivatives as Monoamine Oxidase Inhibitors and Antidepressant/Anticonvulsant Agents|journal=Current Medicinal Chemistry|volume=18|issue=33|year=2011|pages=5114–5144|issn=0929-8673|doi=10.2174/092986711797636090|pmid=22050759}}{{cite journal | vauthors = Kameyama T, Nabeshima T, Yoshida N, Yamaguchi K | title = Neurochemical studies of an analgesic, 1,3-diphenyl-5-(2-dimethylaminopropionamide)-pyrazole [difenamizole] | journal = Res. Commun. Chem. Pathol. Pharmacol. | volume = 31 | issue = 1 | pages = 31–53 | year = 1981 | pmid = 6454942 }}{{cite journal|last1=NABESHIMA|first1=Toshitaka|last2=YAMAGUCHI|first2=Kazumasa|last3=KAMEYAMA|first3=Tsutomu|title=Effects of Difenamizole on Content of Catecholamines and Metabolites in Mouse Brain|journal=The Japanese Journal of Pharmacology|volume=28|issue=4|year=1978|pages=642–646|issn=0021-5198|doi=10.1254/jjp.28.642|pmid=732046|doi-access=free}}
See also
References
{{Reflist|2}}
{{Analgesics}}
{{Dopaminergics}}
Category:Dopamine reuptake inhibitors
Category:Monoamine oxidase inhibitors
Category:Nonsteroidal anti-inflammatory drugs
{{analgesic-stub}}