Morazone

{{Short description|NSAID analgesic drug}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 458950781

| IUPAC_name = 1,5-dimethyl-4-[(3-methyl-2-phenylmorpholin-4-yl)methyl]-2-phenyl-1,2-dihydro-3H-pyrazol-3-one

| image = Morazone.png

| image_class = skin-invert-image

| tradename =

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration = Oral, SC, IM{{ cite book | vauthors = Seyffart G | title = Drug dosage in Renal Insufficiency | publisher = Kluwer Academic Publishers | location = Boston | year = 1991 | page = 399 | isbn = 978-0-7923-0964-2 | url = https://books.google.com/books?id=FubgMz6aOWAC&q=morazone&pg=PA399 }}

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 6536-18-1

| ATC_prefix = none

| ATC_suffix =

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C23H27N3O2/c1-17-21(23(27)26(24(17)3)20-12-8-5-9-13-20)16-25-14-15-28-22(18(25)2)19-10-6-4-7-11-19/h4-13,18,22H,14-16H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = OOGNFQMTGRZRAB-UHFFFAOYSA-N

| PubChem = 39609

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 36216

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 870Q5BL2FN

| C=23 | H=27 | N=3 | O=2

| smiles = c1ccccc1N2N(C)C(C)=C(C2=O)CN3CCOC(C3C)c4ccccc4

}}

Morazone (Novartrina, Orsimon, Rosimon-Neu, Tarcuzate) is a nonsteroidal anti-inflammatory drug (NSAID), originally developed by the German pharmaceutical company Ravensberg in the 1950s, which is used as an analgesic.{{cite patent | country = US | status = patent | number = 2943022 | gdate = 1960-06-28 | invent1 = Siemer, H. | invent2 = Doppstadt, A. | assign1 = Ravensberg | title = Substituted 1-phenyl-2,3-dimethyl-4-morpholino methyl pyrazolone-(5) Compounds and Process of Making Same }}{{cite book | veditors = Buckingham J | title = Dictionary of Organic Compounds | volume = 7 | publisher = Chapman & Hall | location = London | year = 1996 | page = 4659 | isbn = 978-0-412-54090-5 | url = https://books.google.com/books?id=r7z8W69GcoMC&pg=PA4659 }}

It produces phenmetrazine as a major metabolite and has been reported to have been abused as a recreational drug in the past.

{{cite journal | vauthors = Bohn G, Rücker G, Kröger H | title = [Investigations of the decomposition and detection of morazone by thin-layer- and gas-liquid-chromatography] | journal = Archives of Toxicology | volume = 35 | issue = 3 | pages = 213–20 | date = June 1976 | pmid = 989292 | doi = 10.1007/bf00293569 | s2cid = 23956851 }}{{cite journal | vauthors = Neugebauer M | title = Some new urinary metabolites of famprofazone and morazone in man | journal = Journal of Pharmaceutical and Biomedical Analysis | volume = 2 | issue = 1 | pages = 53–60 | year = 1984 | pmid = 16867765 | doi = 10.1016/0731-7085(84)80089-8 }}{{cite journal | vauthors = Kingreen JC, Breger G | title = [Pellagra in morazone abuse] | journal = Zeitschrift für Hautkrankheiten | volume = 59 | issue = 9 | pages = 573–7 | date = May 1984 | pmid = 6145264 }}{{cite journal | vauthors = Daunderer M, Janzen W | title = [ROSIMON-NEU--a non-prescription analgesic on the adolescent drug scene] | journal = Beiträge zur Gerichtlichen Medizin | volume = 29 | pages = 138–43 | year = 1972 | pmid = 5081964 }}

See also

References

{{Reflist|30em}}

{{Anti-inflammatory products}}

{{Analgesics}}

{{Stimulants}}

{{Monoamine releasing agents}}

{{Phenethylamines}}

Category:Beta-Hydroxyamphetamines

Category:Nonsteroidal anti-inflammatory drugs

Category:Norepinephrine-dopamine releasing agents

Category:Phenylmorpholines

Category:Pyrazolones

Category:Stimulants