Difludiazepam

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 7-chloro-5-(2,6-difluorophenyl)-1-methyl-1H-benzo[e] [1,4]diazepin-2(3H)-one

| image = Difludiazepam Structure.svg

| image_class = skin-invert-image

| width = 200

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_UK = PSA

| legal_DE = NpSG

| legal_CA = Schedule IV

| legal_status =

| routes_of_administration =

| addiction_liability =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 39080-67-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7N3B9XEC7B

| ATC_prefix =

| ATC_suffix =

| PubChem = 44366236

| ChemSpiderID = 23222150

| ChEMBL = 346673

| C=16 | H=11 | Cl=1 | F=2 | N=2 | O=1

| melting_point =

| smiles = Fc3cccc(F)c3C2=NCC(=O)N(C)c1ccc(Cl)cc12

| StdInChI=1S/C16H11ClF2N2O/c1-21-13-6-5-9(17)7-10(13)16(20-8-14(21)22)15-11(18)3-2-4-12(15)19/h2-7H,8H2,1H3

| StdInChIKey = DUNFPASORLTEGN-UHFFFAOYSA-N

}}

DifludiazepamMaskell PD, Wilson NE. Designer Benzodiazepines: New Challenges and Treatment Options, in Corazza O, Roman-Urrestarazu. Handbook of Novel Psychoactive Substances: What Clinicians Should Know about NPS. Taylor & Francis, 2019. {{isbn|978-1-138-06830-8}} (Ro07-4065) is a benzodiazepine derivative which is the 2',6'-difluoro derivative of fludiazepam. It was invented in the 1970s but was never marketed, and has been used as a research tool to help determine the shape and function of the GABA_A receptors, at which it has an IC₅₀ of 4.1nM.{{cite journal | vauthors = Winkler DA, Burden FR, Watkins AJ |title=Atomistic Topological Indices Applied to Benzodiazepines using Various Regression Methods |journal=Quantitative Structure-Activity Relationships |date=January 1998 |volume=17 |issue=1 |pages=14–19 |doi=10.1002/(SICI)1521-3838(199801)17:01<14::AID-QSAR14>3.0.CO;2-U}}{{cite journal | vauthors = So SS, Karplus M | title = Genetic neural networks for quantitative structure-activity relationships: improvements and application of benzodiazepine affinity for benzodiazepine/GABAA receptors | journal = Journal of Medicinal Chemistry | volume = 39 | issue = 26 | pages = 5246–5256 | date = December 1996 | pmid = 8978853 | doi = 10.1021/jm960536o }}{{cite journal | vauthors = Maddalena DJ, Johnston GA | title = Prediction of receptor properties and binding affinity of ligands to benzodiazepine/GABAA receptors using artificial neural networks | journal = Journal of Medicinal Chemistry | volume = 38 | issue = 4 | pages = 715–724 | date = February 1995 | pmid = 7861419 | doi = 10.1021/jm00004a017 }} Difludiazepam has subsequently been sold as a designer drug, and was first notified to the EMCDDA by Swedish authorities in 2017.{{cite book | url = http://www.emcdda.europa.eu/system/files/publications/9282/20183924_TDAN18001ENN_PDF.pdf | title = Europol 2017 Annual Report on the implementation of Council Decision 2005/387/JHA | location = Lisbon, Portugal | publisher = European Monitoring Centre for Drugs and Drug Addiction (EMCDDA) and Europol | date = 2018 | isbn = 978-92-9497-348-1 }}{{cite journal | vauthors = Manchester KR, Waters L, Haider S, Maskell PD | title = The blood-to-plasma ratio and predicted GABAA-binding affinity of designer benzodiazepines | journal = Forensic Toxicology | volume = 40 | issue = 2 | pages = 349–356 | date = July 2022 | pmid = 36454409 | pmc = 9715504 | doi = 10.1007/s11419-022-00616-y }}