Ro07-5220

{{Short description|Chemical compound}}

{{drugbox

| drug_name = Ro07-5220

| image = Ro07-5220.svg

| image_class = skin-invert-image

| legal_CA = Schedule IV

| legal_UK = PSA

| legal_DE = NpSG

| C = 16 | H = 11 | Cl = 3 | N = 2 | O = 1

| IUPAC_name = 7-chloro-5-(2,6-dichlorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one

| CAS_number = 30144-88-8

| ChemSpiderID = 8150988

| PubChem = 9975396

| ChEMBL = 9689

| smiles = CN1C(=O)CN=C(C2=C1C=CC(=C2)Cl)C3=C(C=CC=C3Cl)Cl

| StdInChI = 1S/C16H11Cl3N2O/c1-21-13-6-5-9(17)7-10(13)16(20-8-14(21)22)15-11(18)3-2-4-12(15)19/h2-7H,8H2,1H3

| StdInChIKey = OTQXKRRISJPTFS-UHFFFAOYSA-N

}}

Ro07-5220 (6'-Chlorodiclazepam) is a benzodiazepine derivative with sedative, anxiolytic, anticonvulsant and muscle relaxant effects,{{cite journal | vauthors = Fryer RI, Leimgruber W, Trybulski EJ | title = Quinazolines and 1,4-benzodiazepines. 90. Structure-activity relationship between substituted 2-amino-N-(2-benzoyl-4-chlorophenyl)acetamides and 1,4-benzodiazepinones | journal = Journal of Medicinal Chemistry | volume = 25 | issue = 9 | pages = 1050–5 | date = September 1982 | pmid = 6127410 | doi = 10.1021/jm00351a009 }}{{cite journal | vauthors = Maddalena DJ, Johnston GA | title = Prediction of receptor properties and binding affinity of ligands to benzodiazepine/GABAA receptors using artificial neural networks | journal = Journal of Medicinal Chemistry | volume = 38 | issue = 4 | pages = 715–24 | date = February 1995 | pmid = 7861419 | doi = 10.1021/jm00004a017 }}{{cite journal | vauthors = Richter L, de Graaf C, Sieghart W, Varagic Z, Mörzinger M, de Esch IJ, Ecker GF, Ernst M | title = Diazepam-bound GABAA receptor models identify new benzodiazepine binding-site ligands | journal = Nature Chemical Biology | volume = 8 | issue = 5 | pages = 455–64 | date = March 2012 | pmid = 22446838 | pmc = 3368153 | doi = 10.1038/nchembio.917 }} which has been sold as a designer drug.{{cite journal | vauthors = Catalani V, Botha M, Corkery JM, Guirguis A, Vento A, Scherbaum N, Schifano F | title = The Psychonauts' Benzodiazepines; Quantitative Structure-Activity Relationship (QSAR) Analysis and Docking Prediction of Their Biological Activity | journal = Pharmaceuticals (Basel, Switzerland) | volume = 14 | issue = 8 | date = July 2021 | page = 720 | pmid = 34451817 | pmc = 8398354 | doi = 10.3390/ph14080720 | doi-access = free }}