Dimetacrine
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = 3-(9,9-Dimethylacridin-10-yl)-N,N-dimethyl-propan-1-amine
| image = Dimetacrine v2.svg
| width = 150
| image_class = skin-invert-image
| alt = Skeletal formula of dimetacrine
| image2 = Dimetacrine-3D-balls.png
| alt2 = Ball-and-stick model of the dimetacrine molecule
| width2 = 175
| tradename = Istonil, Istonyl, Linostil, Miroistonil
| pregnancy_category =
| legal_AU =
| legal_BR = C1
| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-04-04}}
| legal_CA =
| legal_DE =
| legal_NZ =
| legal_UK =
| legal_US =
| legal_EU =
| legal_UN =
| legal_status = Rx-only
| routes_of_administration = Oral
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| synonyms = Dimethacrine, acripramine
| CAS_number = 4757-55-5
| ATC_prefix = N06
| ATC_suffix = AA18
| PubChem = 94280
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB08996
| ChemSpiderID = 85085
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = O341NY501N
| KEGG = D02565
| C=20 | H=26 | N=2
| smiles = CC1(C2=CC=CC=C2N(C3=CC=CC=C31)CCCN(C)C)C
}}
Dimetacrine (also known as dimethacrine and acripramine; brand names Istonil, Istonyl, Linostil, and Miroistonil) is a tricyclic antidepressant (TCA) used in Europe and formerly in Japan for the treatment of depression.{{cite book | title = Dictionary of organic compounds | publisher = Chapman & Hall | location = London | year = 1996 | isbn = 0-412-54090-8 | url = https://books.google.com/books?id=_8TyJT0RfN0C&pg=PA2519}}{{cite book | vauthors = Kato S | chapter = A Review of the Pharmacotherapy of Depression in Japan | veditors = Kariya T, Nakagawara M |title=Affective Disorders: Perspective on Basic Research and Clinical Practice |date=1993 |publisher=Seiwa Shoten |location=Tokyo |isbn=978-0-87630-674-1 | chapter-url = https://books.google.com/books?id=XLItppcgYugC&pg=PA117 }}{{cite book | vauthors = Vela JM, Buschmann H, Holenz J, Párraga A, Torrens A | title = Antidepressants, Antipsychotics, Anxiolytics: From Chemistry and Pharmacology to Clinical Application | publisher = Wiley-VCH | location = Weinheim | year = 2007 | isbn = 978-3-527-31058-6 }}{{cite journal | vauthors = Taen S, Pöldinger W | title = [Dimethacrine (istonil), an acridane derivative with the antidepressive action] | language = de | journal = Schweizerische Medizinische Wochenschrift | volume = 96 | issue = 48 | pages = 1616–1620 | date = December 1966 | pmid = 6008540 }}{{cite journal | vauthors = Meyer R | title = [Contribution to the clinical evaluation of the antidepressive effect of dimethacrine (Istonil)] | language = de | journal = Praxis | volume = 57 | issue = 20 | pages = 721–723 | date = May 1968 | pmid = 5756370 }} It has imipramine-like effects; though, in a double-blind clinical trial against imipramine, dimetacrine was found to have lower efficacy in comparison and produced more weight loss and abnormal liver tests.{{cite journal | vauthors = Abuzzahab FS | title = A double-blind investigation of dimethacrine versus imipramine in hospitalized depressive states | journal = International Journal of Clinical Pharmacology, Therapy and Toxicology | volume = 8 | issue = 3 | pages = 244–253 | date = November 1973 | pmid = 4149236 }}{{cite book | vauthors = Mutschler E, Derendorf H | chapter = Psychoactive Drugs: Antidepresants | title = Drug actions: basic principles and therapeutic aspects | publisher = Medpharm Scientific Pub | location = Stuttgart, Germany | year = 1995 | isbn = 0-8493-7774-9 | chapter-url = https://books.google.com/books?id=IvN4mZxraMkC&q=dimetacrine&pg=PA127 | access-date = January 30, 2013}}
Little is known about the pharmacology of dimetacrine,{{Cite web | work = PubChem | publisher = U.S. National Library of Medicine |title=Dimetacrine |url=https://pubchem.ncbi.nlm.nih.gov/compound/94280 |access-date=2023-11-03 |language=en}} but it can be inferred that it acts in a similar manner to other TCAs. If this is indeed the case, dimetacrine may induce severe cardiac toxicity in overdose (a side effect unique to the tricyclic class of antidepressants).
See also
References
{{Reflist|30em}}
{{Antidepressants}}
{{Navboxes
| title = Pharmacodynamics
| titlestyle = background:#ccccff
| list1 =
{{Adrenergic receptor modulators}}
{{Histamine receptor modulators}}
{{Monoamine reuptake inhibitors}}
{{Muscarinic acetylcholine receptor modulators}}
{{Serotonin receptor modulators}}
}}
{{Tricyclics}}