Draft:AB-MDMSBA
{{AFC submission|d|exists|AB-MDMSBA|u=BCanalyst|ns=118|decliner=Fade258|declinets=20250613144918|ts=20250612233350}}
{{AFC submission|d|nn|u=BCanalyst|ns=118|decliner=DoubleGrazing|declinets=20250609073307|small=yes|ts=20250609072659}}
{{AFC comment|1=There is already an article on this topic. Fade258 (talk) 14:49, 13 June 2025 (UTC)}}
{{AFC comment|1=In accordance with Wikipedia's Conflict of interest policy, I disclose that I have a conflict of interest regarding the subject of this article. BCanalyst (talk) 07:25, 9 June 2025 (UTC)}}
----
{{Short description|Designer drug }}
{{Draft topics|chemistry|medicine-and-health}}
{{AfC topic|other}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug
| drug_name =
| INN =
| type =
| image = AB-MDMSBA.tif
| width =
| alt =
| caption =
| image2 =
| width2 =
| alt2 =
| caption2 =
| imageL =
| widthL =
| altL =
| imageR =
| widthR =
| altR =
| captionLR =
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| licence_CA =
| licence_EU =
| DailyMedID =
| licence_US =
| pregnancy_AU =
| pregnancy_AU_comment =
| pregnancy_category =
| dependency_liability =
| addiction_liability =
| routes_of_administration =
| class =
| ATCvet =
| ATC_prefix =
| ATC_suffix =
| ATC_supplemental =
| legal_AU =
| legal_AU_comment =
| legal_BR =
| legal_BR_comment =
| legal_CA =
| legal_CA_comment =
| legal_DE =
| legal_DE_comment =
| legal_NZ =
| legal_NZ_comment =
| legal_UK =
| legal_UK_comment =
| legal_US =
| legal_US_comment =
| legal_EU =
| legal_EU_comment =
| legal_UN =
| legal_UN_comment =
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action =
| excretion =
| CAS_number =
| CAS_supplemental =
| PubChem = 172872001
| PubChemSubstance =
| IUPHAR_ligand =
| DrugBank =
| ChemSpiderID =
| UNII =
| KEGG =
| ChEBI =
| ChEMBL =
| NIAID_ChemDB =
| PDB_ligand =
| synonyms =
| IUPAC_name =
| C = 15
| H = 23
| N = 3
| O = 4
| S = 1
| molecular_weight =
| SMILES = CC1=C(C=C(C=C1)C(=O)N[C@@H](C(C)C)C(=O)N)S(=O)(=O)N(C)C
| Jmol =
| StdInChI = InChI=1S/C15H23N3O4S/c1-9(2)13(14(16)19)17-15(20)11-7-6-10(3)12(8-11)23(21,22)18(4)5/h6-9,13H,1-5H3,(H2,16,19)(H,17,20)/t13-/m0/s1
| StdInChI_comment =
| StdInChIKey = KYNAATZHNRULED-ZDUSSCGKSA-N
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}}
AB-MDMSBA is a novel synthetic compound that has been sold as a designer drug. It has been detected by drug checking services in Australia and New Zealand being misrepresented as a benzodiazepine.{{Cite web | title = Synthetic cannabinoid AB-MDMSBA found in 'benzodiazepine' samples - The Know | date = 2024-12-10 | url = https://theknow.org.au/alerts_warnings/synthetic-cannabinoid-ab-mdmsba-found-in-benzodiazepine-samples/ | access-date = 2025-06-10 | website = theknow.org.au | language = en }}{{Cite web | title = New synthetic cannabinoid misrepresented as a benzodiazepine | url = https://www.highalert.nz/alerts-and-notifications/new-synthetic-cannabinoid-misrepresented-as-a-benzodiazepine/ | access-date = 2025-06-10 | website = High Alert | language = en }}
It is structurally similar to other arylsulfonamide-based synthetic cannabinoid
References
{{Reflist}}