QMPSB
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = 8-quinolinyl 4-methyl-3-(1-piperidinylsulfonyl)benzoate
| image = QMPSB structure.svg
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA = Schedule II
| legal_UK = PSA
| legal_US =
| legal_DE = NpSG
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 312606-87-4
| ATC_prefix =
| ATC_suffix =
| PubChem = 3929482
| smiles = Cc1ccc(cc1[S](=O)(=O)N2CCCCC2)C(=O)Oc3cccc4cccnc34
| ChemSpiderID = 3151524
| StdInChI = 1S/C22H22N2O4S/c1-16-10-11-18(15-20(16)29(26,27)24-13-3-2-4-14-24)22(25)28-19-9-5-7-17-8-6-12-23-21(17)19/h5-12,15H,2-4,13-14H2,1H3
| StdInChIKey = WORIMYADZQJWOU-UHFFFAOYSA-N
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 55Q8B94HS5
| ChEMBL = 245876
| C=22 | H=22 | N=2 | O=4 | S=1
| molecular_weight =
}}
QMPSB is an arylsulfonamide-based synthetic cannabinoid that has been sold as a designer drug.{{cite journal | vauthors = Blakey K, Boyd S, Atkinson S, Wolf J, Slottje PM, Goodchild K, McGowan J | title = Identification of the novel synthetic cannabimimetic 8-quinolinyl 4-methyl-3-(1-piperidinylsulfonyl)benzoate (QMPSB) and other designer drugs in herbal incense | journal = Forensic Science International | volume = 260 | pages = 40–53 | date = March 2016 | pmid = 26795397 | doi = 10.1016/j.forsciint.2015.12.001 | doi-access = free }}
QMPSB was first discovered by Nathalie Lambeng and colleagues in 2007. It acts as a full agonist of the CB1 receptor and CB2 receptor with Ki values of 3 nM and 4 nM, respectively.{{cite journal | vauthors = Lambeng N, Lebon F, Christophe B, Burton M, De Ryck M, Quéré L | title = Arylsulfonamides as a new class of cannabinoid CB1 receptor ligands: identification of a lead and initial SAR studies | journal = Bioorganic & Medicinal Chemistry Letters | volume = 17 | issue = 1 | pages = 272–7 | date = January 2007 | pmid = 17027269 | doi = 10.1016/j.bmcl.2006.09.049 }} Many related derivatives were subsequently produced, with the main focus of this work being to increase selectivity for the non-psychoactive CB2 receptor.{{cite journal | vauthors = Ermann M, Riether D, Walker ER, Mushi IF, Jenkins JE, Noya-Marino B, Brewer ML, Taylor MG, Amouzegh P, East SP, Dymock BW, Gemkow MJ, Kahrs AF, Ebneth A, Löbbe S, O'Shea K, Shih DT, Thomson D | display-authors = 6 | title = Arylsulfonamide CB2 receptor agonists: SAR and optimization of CB2 selectivity | journal = Bioorganic & Medicinal Chemistry Letters | volume = 18 | issue = 5 | pages = 1725–9 | date = March 2008 | pmid = 18255291 | doi = 10.1016/j.bmcl.2008.01.042 }}{{cite journal | vauthors = Worm K, Zhou QJ, Saeui CT, Green RC, Cassel JA, Stabley GJ, DeHaven RN, Conway-James N, LaBuda CJ, Koblish M, Little PJ, Dolle RE | display-authors = 6 | title = Sulfamoyl benzamides as novel CB2 cannabinoid receptor ligands | journal = Bioorganic & Medicinal Chemistry Letters | volume = 18 | issue = 9 | pages = 2830–5 | date = May 2008 | pmid = 18430570 | doi = 10.1016/j.bmcl.2008.04.006 }}{{cite journal | vauthors = Goodman AJ, Ajello CW, Worm K, Le Bourdonnec B, Savolainen MA, O'Hare H, Cassel JA, Stabley GJ, Dehaven RN, Labuda CJ, Koblish M, Little PJ, Brogdon BL, Smith SA, Dolle RE | display-authors = 6 | title = CB2 selective sulfamoyl benzamides: optimization of the amide functionality | journal = Bioorganic & Medicinal Chemistry Letters | volume = 19 | issue = 2 | pages = 309–13 | date = January 2009 | pmid = 19091565 | doi = 10.1016/j.bmcl.2008.11.091 }}{{cite journal | vauthors = Sellitto I, Le Bourdonnec B, Worm K, Goodman A, Savolainen MA, Chu GH, Ajello CW, Saeui CT, Leister LK, Cassel JA, Dehaven RN, Labuda CJ, Koblish M, Little PJ, Brogdon BL, Smith SA, Dolle RE | display-authors = 6 | title = Novel sulfamoyl benzamides as selective CB(2) agonists with improved in vitro metabolic stability | journal = Bioorganic & Medicinal Chemistry Letters | volume = 20 | issue = 1 | pages = 387–91 | date = January 2010 | pmid = 19919895 | doi = 10.1016/j.bmcl.2009.10.062 }} This work led on from an earlier series of sulfamoyl benzamide derivatives for which a patent was filed in 2004.{{cite patent
| country = US
| number = 7297796
| status = application
| title = Sulfamoyl benzamide derivatives and methods of their use
| pubdate = Nov 20, 2007
| fdate = Oct 13, 2005
| pridate = Oct 13, 2004
| invent1 = Roland E. Dolle, Karin Worm, Q. Jean Zhou
| assign1 = Adolor Corporation}}
The quinolin-8-yl ester motif of QMPSB led to the discovery of other designer cannabinoids such as PB-22 and BB-22.{{cite journal | vauthors = Brandt SD, Kavanagh PV, Westphal F, Dreiseitel W, Dowling G, Bowden MJ, Williamson JP | title = Synthetic cannabinoid receptor agonists: analytical profiles and development of QMPSB, QMMSB, QMPCB, 2F-QMPSB, QMiPSB, and SGT-233. | journal = Drug Testing and Analysis | date = 2020 | volume = 13 | issue = 1 | pages = 175–196 | doi = 10.1002/dta.2913 | pmid = 32880103 | doi-access = free }}