Ethallobarbital
{{short description|Chemical compound}}
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 447554114
| IUPAC_name = 5-ethyl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione
| image = Ethallobarbital.svg
| width = 150
| tradename =
| pregnancy_category =
| legal_status =
| legal_US = Schedule III
| routes_of_administration = Oral
| bioavailability =
| metabolism = Hepatic
| elimination_half-life =
| excretion = Renal
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 2373-84-4
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 6F1R68CB4I
| ATC_prefix = N05
| ATC_suffix = CA20
| PubChem = 48542
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 44152
| synonyms = Aethallymal, Aethylal, Etallobarbital, Go 1067
| C=9 | H=12 | N=2 | O=3
| smiles = O=C1NC(=O)NC(=O)C1(CC)C\C=C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C9H12N2O3/c1-3-5-9(4-2)6(12)10-8(14)11-7(9)13/h3H,1,4-5H2,2H3,(H2,10,11,12,13,14)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = QPADNTZLUBYNEN-UHFFFAOYSA-N
}}
Ethallobarbital (brand names Dormin, Dumex, Dormitiv, Dorval), also known as ethallymal and 5-allyl-5-ethylbarbituric acid, is an allyl-substituted barbiturate described as a sedative/hypnotic.{{cite book| vauthors = Ganellin CR, Triggle DJ |title=Dictionary of Pharmacological Agents |url=https://books.google.com/books?id=DeX7jgInYFMC&pg=PA51 |date=21 November 1996|publisher=CRC Press|isbn=978-0-412-46630-4|pages=51–}}{{cite book| vauthors = Negwer M |title=Organic-chemical drugs and their synonyms: an international survey|url=https://books.google.com/books?id=8SdtAAAAMAAJ|year=1978|publisher=Akademie-Verlag|isbn=978-0-89573-100-5}}{{cite book| vauthors = Muller NF, Dessing RP |title=European Drug Index: European Drug Registrations | edition = Fourth |url=https://books.google.com/books?id=HiSdvzs2pPAC&pg=PA1440 |date=19 June 1998 |publisher=CRC Press |isbn=978-3-7692-2114-5|pages=1440–}}{{cite book| vauthors = Frigerio A, McCamish M |title=Recent Developments in Mass Spectrometry in Biochemistry and Medicine|url=https://books.google.com/books?id=orfwAAAAMAAJ|year=1980|publisher=Elsevier Scientific Publishing Company| isbn = 9780444418708 }}{{cite journal | vauthors = Goldhahn H, Barth H | title = [Barbituric acids. II] | journal = Pharmazie | volume = 8 | issue = 11 | pages = 913–8 |date=November 1953 | pmid = 13133697 }} It was first synthesized in 1927.
See also
References
{{Reflist}}
{{Hypnotics and sedatives}}
{{GABAAR PAMs}}
Category:Substances discovered in the 1920s
{{sedative-stub}}