FDU-NNE1
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = [1-(4-fluorobenzyl)-N-(naphthalen-1-yl)-1H-indole-3-carboxamide
| image = FDU-NNE1_structure.png
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA = Schedule II
| legal_DE = NpSG
| legal_UK = Class B
| legal_US =
| legal_NZ =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref =
| CAS_number = 2365471-76-5
| ATC_prefix =
| ATC_suffix =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = M5H92FEG4W
| PubChem = 122213806
| ChemSpiderID = 58794744
| smiles = O=C(C1=CN(CC2=CC=C(F)C=C2)C3=C1C=CC=C3)NC4=C(C=CC=C5)C5=CC=C4
| StdInChI = 1S/C26H19FN2O/c27-20-14-12-18(13-15-20)16-29-17-23(22-9-3-4-11-25(22)29)26(30)28-24-10-5-7-19-6-1-2-8-21(19)24/h1-15,17H,16H2,(H,28,30)
| StdInChIKey = XYSIFMHZXZATQO-UHFFFAOYSA-N
| C=26 | H=19 | F=1 | N=2 | O=1
}}
FDU-NNE1 (also known as FDU-NNEI and FDU-MN-24) is an indole-based synthetic cannabinoid that is presumed to be a potent agonist of the CB1 receptor and has been sold online as a designer drug.{{cite web | url=https://www.caymanchem.com/app/template/Product.vm/catalog/17495 | title=FDU-NNEI | publisher=Cayman Chemical | access-date=23 July 2015}}{{cite journal | vauthors = Uchiyama N, Shimokawa Y, Kikura-Hanajiri R, Demizu Y, Goda Y, Hakamatsuka T | title = N-OH-EDMA, and a cathinone derivative dimethoxy-α-PHP, newly identified in illegal products | journal = Forensic Toxicology | volume = 33 | issue = 2 | pages = 244–259 | date = February 2015 | pmid = 26257833 | pmc = 4525202 | doi = 10.1007/s11419-015-0268-7 }} Given the known metabolic liberation (and presence as an impurity) of amantadine in the related compound APINACA, it is suspected that metabolic hydrolysis of the amide group of FDU-NNE1 will release 1-naphthylamine, a known carcinogen.