FDU-PB-22

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = naphthalen-1-yl 1-[(4-fluorophenyl)methyl]-1H-indole-3-carboxylate

| image = FDU-PB-22_structure.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA = Schedule II

| legal_UK = Class B

| legal_US =

| legal_DE = Anlage II

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 1883284-94-3

| ATC_prefix =

| ATC_suffix =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 85E88884ZQ

| PubChem = 119025888

| ChemSpiderID = 29763739

| smiles = O=C(OC1=C(C=CC=C2)C2=CC=C1)C3=CN(CC4=CC=C(F)C=C4)C5=C3C=CC=C5

| StdInChI = 1S/C26H18FNO2/c27-20-14-12-18(13-15-20)16-28-17-23(22-9-3-4-10-24(22)28)26(29)30-25-11-5-7-19-6-1-2-8-21(19)25/h1-15,17H,16H2

| StdInChIKey = RCEKSVIFQKKFLS-UHFFFAOYSA-N

| C=26 | H=18 | F=1 | N=1 | O=2

}}

FDU-PB-22 is a derivative of JWH-018 that is presumed to be a potent agonist of the CB₁ receptor, and has been sold online as a designer drug.{{cite web | url=http://forendex.southernforensic.org/index.php/detail/index/1279 | title=FDU-PB-22 | publisher=Southern Association of Forensic Scientists | access-date=23 July 2015 | archive-url=https://web.archive.org/web/20150527210102/http://forendex.southernforensic.org/index.php/detail/index/1279 | archive-date=27 May 2015 | url-status=dead }}{{cite journal | vauthors = Uchiyama N, Shimokawa Y, Kikura-Hanajiri R, Demizu Y, Goda Y, Hakamatsuka T | title = N-OH-EDMA, and a cathinone derivative dimethoxy-α-PHP, newly identified in illegal products | journal = Forensic Toxicology | volume = 33 | issue = 2 | pages = 244–259 | date = 1 July 2015 | pmid = 26257833 | pmc = 4525202 | doi = 10.1007/s11419-015-0268-7 }}