FLUORETH-LAD

{{Short description|Chemical compound}}

{{Drugbox

| image = FLUOROETH-LAD_structure.png

| width = 200px

| tradename =

| routes_of_administration =

| class = Serotonin receptor modulator

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 2757566-18-8

| ATC_prefix =

| PubChem = 168105608

| ChemSpiderID =

| synonyms = TRALA-15; FE-LAD; 6-(2-Fluoroethyl)-6-nor-LSD; 6-(2-Fluoroethyl)-LAD; N,N-Diethyl-6-(2-fluoroethyl)-9,10-didehydroergoline-8β-carboxamide

| IUPAC_name = (6aR,9R)-N,N-diethyl-7-(2-fluoroethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide

| C=21 | H=26 | F=1 | N=3 | O=1

| SMILES = CCN(CC)C(=O)[C@H]1CN([C@@H]2CC3=CNC4=CC=CC(=C34)C2=C1)CCF

| StdInChI = 1S/C21H26FN3O/c1-3-24(4-2)21(26)15-10-17-16-6-5-7-18-20(16)14(12-23-18)11-19(17)25(13-15)9-8-22/h5-7,10,12,15,19,23H,3-4,8-9,11,13H2,1-2H3/t15-,19-/m1/s1

| StdInChIKey = UYFDKYZWVLEHQH-DNVCBOLYSA-N

}}

FLUORETH-LAD (TRALA-15)[https://patents.google.com/patent/US20230414583A1 Trachsel D, et al. Lysergic acid derivatives with modified LSD-like action. US 2023/0414583], or FE-LAD, also known as 6-(2-fluoroethyl)-LAD or 6-(2-fluoroethyl)-6-nor-LSD, is a lysergamide derivative. It was first proposed by Alexander and Ann Shulgin in their book TiHKAL,[https://erowid.org/library/books_online/tihkal/tihkal51.shtml TIHKAL #51: PRO-LAD] but was never synthesised by Shulgin. Synthesis and activity data for the compound were first reported in a 2022 patent by Matthias Grill, in which pharmacological testing showed it to have similar affinity to LSD at some targets such as the 5-HT_1A and 5-HT_2A serotonin receptors, but much lower affinity at other targets such as 5-HT_2C and at dopamine receptors, giving it comparatively greater selectivity compared to LSD. Currently new lysergamide derivates are in the development phase at MiHKAL GmbH in Switzerland.{{cite patent | url = https://patentscope.wipo.int/search/en/detail.jsf?docId=WO2022008627 | inventor = Grill M | title = Improved Method for the Production of Lysergic Acid Diethylamide (LSD) and Novel Derivatives thereof.| country = WO | number = 2022/008627 }}