Fenquizone

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 437186489

| IUPAC_name = 7-chloro-4-oxo-2-phenyl-1,2,3,4-tetrahydroquinazoline-6-sulfonamide

| image = Fenquizone.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 20287-37-0

| ATC_prefix = C03

| ATC_suffix = BA13

| PubChem = 68548

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 61822

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = LJ1U13R8IK

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D04161

| C=14 | H=12 | Cl=1 | N=3 | O=3 | S=1

| smiles = O=S(=O)(c3c(Cl)cc2c(C(=O)NC(c1ccccc1)N2)c3)N

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C14H12ClN3O3S/c15-10-7-11-9(6-12(10)22(16,20)21)14(19)18-13(17-11)8-4-2-1-3-5-8/h1-7,13,17H,(H,18,19)(H2,16,20,21)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = DBDTUXMDTSTPQZ-UHFFFAOYSA-N

}}

Fenquizone (INN) is a diuretic, part of the class of low-ceiling sulfonamide diuretics.{{cite journal |vauthors=Ferrando C, Foy JM, Pratt CN, Purvis JR |title=On the pharmacological actions of a diuretic, fenquizone, with particular reference to its site of action |journal=The Journal of Pharmacy and Pharmacology |volume=33 |issue=4 |pages=219–22 |date=April 1981 |pmid=6115903 |doi=10.1111/j.2042-7158.1981.tb13761.x}} Fenquizone is used primarily in the treatment of oedema and hypertension.{{cite web |url=http://www.mims.com/Page.aspx?menuid=mng&name=fenquizone&h=fenquizone&CTRY=TH |title=Fenquizone |work=Drug Information from MIMS |location=Thailand }}{{Dead link|date=April 2024 |bot=InternetArchiveBot |fix-attempted=yes }}