Quinethazone

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 464378622

| IUPAC_name = 7-chloro-2-ethyl-4-oxo-1,2,3,4-tetrahydroquinazoline-
6-sulfonamide

| image = Quinethazone.svg

| tradename =

| Drugs.com = {{drugs.com|CONS|quinethazone}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US =

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 7289

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 73-49-4

| ATC_prefix = C03

| ATC_suffix = BA02

| PubChem = 6307

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB01325

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 6068

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 455E0S048W

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D00461

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1532

| C=10 | H=12 | Cl=1 | N=3 | O=3 | S=1

| smiles = O=S(=O)(c2c(Cl)cc1c(C(=O)NC(N1)CC)c2)N

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C10H12ClN3O3S/c1-2-9-13-7-4-6(11)8(18(12,16)17)3-5(7)10(15)14-9/h3-4,9,13H,2H2,1H3,(H,14,15)(H2,12,16,17)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = AGMMTXLNIQSRCG-UHFFFAOYSA-N

}}

Quinethazone (INN, brand name Hydromox) is a thiazide-like diuretic used to treat hypertension.{{cite journal | vauthors = Sandler G | title = Quinethazone, a new oral diuretic | journal = British Medical Journal | volume = 2 | issue = 5404 | pages = 288–92 | date = August 1964 | pmid = 14160213 | pmc = 1815620 | doi = 10.1136/bmj.2.5404.288 | url = }} Common side effects include dizziness, dry mouth, nausea, and low potassium levels.