Forsythoside B
{{Short description|Chemical compound}}
{{Drugbox
| drug_name =
| type =
| IUPAC_name =
| image = Forsythoside-B_structure.png
| width = 300
| alt =
| caption =
| tradename =
| MedlinePlus =
| licence_EU =
| licence_US =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_US =
| legal_status =
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 81525-13-5
| PubChem = 23928102
| ChEMBL =
| ChEBI =
| UNII =
| DrugBank =
| ChemSpiderID = 22912890
| C = 34
| H = 44
| O = 19
| SMILES = C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]([C@@H](O[C@@H]([C@H]2OC(=O)/C=C/C3=CC(=C(C=C3)O)O)CO[C@H]4[C@@H]([C@](CO4)(CO)O)O)OCCC5=CC(=C(C=C5)O)O)O)O)O)O
| StdInChI = 1S/C34H44O19/c1-15-24(41)25(42)26(43)32(50-15)53-29-27(44)31(47-9-8-17-3-6-19(37)21(39)11-17)51-22(12-48-33-30(45)34(46,13-35)14-49-33)28(29)52-23(40)7-4-16-2-5-18(36)20(38)10-16/h2-7,10-11,15,22,24-33,35-39,41-46H,8-9,12-14H2,1H3/b7-4+/t15-,22+,24-,25+,26+,27+,28+,29+,30-,31+,32-,33+,34+/m0/s1
| StdInChIKey = JMBINOWGIHWPJI-UNSOMVRXSA-N
}}
Forsythoside B is a natural product from the phenylpropanoid/polyphenolic glycoside group, which is found in a number of plant species in the mint order such as Marrubium alysson, Phlomis armeniaca, Scutellaria salviifolia, Phlomoides tuberosa, Phlomoides rotata, Pedicularis longiflora and Teucrium chamaedrys, several of which are used in Chinese traditional medicine in preparations such as Shuanghuanglian (双黄连). It acts as an inhibitor of inflammatory mediators such as TNF-alpha, IL-6, IκB and NF-κB, as well as the temperature sensitive channel TRPV3, but also activates the RhoA/ROCK signaling pathway which can cause hypersensitivity reactions when it is injected intravenously.{{cite journal | vauthors = Caliş I, Hosny M, Khalifa T, Rüedi P | title = Phenylpropanoid glycosides from Marrubium alysson | journal = Phytochemistry | volume = 31 | issue = 10 | pages = 3624–6 | date = October 1992 | pmid = 1368865 | doi = 10.1016/0031-9422(92)83740-p }}{{cite journal | vauthors = Saracoglu I, Inoue M, Calis I, Ogihara Y | title = Studies on constituents with cytotoxic and cytostatic activity of two Turkish medicinal plants Phlomis armeniaca and Scutellaria salviifolia | journal = Biological & Pharmaceutical Bulletin | volume = 18 | issue = 10 | pages = 1396–400 | date = October 1995 | pmid = 8593444 | doi = 10.1248/bpb.18.1396 | doi-access = free }}{{cite journal | vauthors = Jiang WL, Fu FH, Xu BM, Tian JW, Zhu HB | title = Cardioprotection with forsythoside B in rat myocardial ischemia-reperfusion injury: relation to inflammation response | journal = Phytomedicine | volume = 17 | issue = 8–9 | pages = 635–9 | date = July 2010 | pmid = 19959348 | doi = 10.1016/j.phymed.2009.10.017 }}{{cite journal | vauthors = Jiang WL, Zhang SP, Zhu HB | title = Forsythoside B protects against experimental sepsis by modulating inflammatory factors | journal = Phytotherapy Research | volume = 26 | issue = 7 | pages = 981–7 | date = July 2012 | pmid = 22147417 | doi = 10.1002/ptr.3668 | s2cid = 32769238 | doi-access = free }}{{cite journal | vauthors = Dimitrova P, Kostadinova E, Milanova V, Alipieva K, Georgiev M, Ivanovska N | title = Antiinflammatory properties of extracts and compounds isolated from Verbascum xanthophoeniceum Griseb | journal = Phytotherapy Research | volume = 26 | issue = 11 | pages = 1681–7 | date = November 2012 | pmid = 22389249 | doi = 10.1002/ptr.4641 | s2cid = 206428570 }}{{cite journal | vauthors = Frezza C, Venditti A, Matrone G, Serafini I, Foddai S, Bianco A, Serafini M | title = Iridoid glycosides and polyphenolic compounds from Teucrium chamaedrys L | journal = Natural Product Research | volume = 32 | issue = 13 | pages = 1583–1589 | date = July 2018 | pmid = 29058476 | doi = 10.1080/14786419.2017.1392948 | s2cid = 46602138 | url = https://figshare.com/articles/journal_contribution/5527183 | url-access = subscription }}{{cite journal | vauthors = Zhang H, Sun X, Qi H, Ma Q, Zhou Q, Wang W, Wang K | title = Pharmacological Inhibition of the Temperature-Sensitive and Ca2+-Permeable Transient Receptor Potential Vanilloid TRPV3 Channel by Natural Forsythoside B Attenuates Pruritus and Cytotoxicity of Keratinocytes | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 368 | issue = 1 | pages = 21–31 | date = January 2019 | pmid = 30377214 | doi = 10.1124/jpet.118.254045 | doi-access = free }}{{cite journal | vauthors = Liu JX, Li X, Yan FG, Pan QJ, Yang C, Wu MY, Li G, Liu HF | display-authors = 6 | title = Protective effect of forsythoside B against lipopolysaccharide-induced acute lung injury by attenuating the TLR4/NF-κB pathway | journal = International Immunopharmacology | volume = 66 | pages = 336–346 | date = January 2019 | pmid = 30521962 | doi = 10.1016/j.intimp.2018.11.033 | s2cid = 56141148 }}{{cite journal | vauthors = Han J, Zhang Y, Pan C, Xian Z, Pan C, Zhao Y, Li C, Yi Y, Wang L, Tian J, Liu S, Wang D, Meng J, Liang A | display-authors = 6 | title = Forsythoside A and Forsythoside B Contribute to Shuanghuanglian Injection-Induced Pseudoallergic Reactions through the RhoA/ROCK Signaling Pathway | journal = International Journal of Molecular Sciences | volume = 20 | issue = 24 | date = December 2019 | page = 6266 | pmid = 31842335 | doi = 10.3390/ijms20246266|pmc=6940901 | doi-access = free }}{{cite journal | vauthors = Yan K, Sun X, Wang G, Liu Y, Wang K | title = Pharmacological Activation of Thermo-Transient Receptor Potential Vanilloid 3 Channels Inhibits Hair Growth by Inducing Cell Death of Hair Follicle Outer Root Sheath | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 370 | issue = 2 | pages = 299–307 | date = August 2019 | pmid = 31152005 | doi = 10.1124/jpet.119.258087 | doi-access = free }}