Fuculose

{{chembox

| verifiedrevid = 447363246

| Name = {{sm|l}}-Fuculose

| ImageFile = L-Fuculose_furanose_chemical_structure.png

| ImageSize = 120px

| ImageClass = skin-invert-image

| ImageFile2 = L-Fuculose_chemical_structure.png

| ImageSize2 = 140px

| ImageClass2 = skin-invert-image

| SystematicName = (3R,4S,5S)-2-(Hydroxymethyl)-5-methyltetrahydrofuran-2,3,4-triol

| IUPACName = 6-Deoxy-{{sm|l}}-tagatose

| Section1 = {{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 13074-08-3

| ChEBI = 17617

| ChemSpiderID = 9621375

| KEGG = C01721

| PubChem = 6857362

| StdInChI=1S/C6H12O5/c1-3(8)5(10)6(11)4(9)2-7/h3,5-8,10-11H,2H2,1H3/t3-,5+,6-/m0/s1

| StdInChIKey = QZNPNKJXABGCRC-LFRDXLMFSA-N

| SMILES = O[C@H]1[C@@H](O)C(O)(CO)O[C@H]1C }}

| Section2 = {{Chembox Properties

| Formula = C₆H₁₂O₅

| MolarMass = 164.16 g/mol

}}

}}

Fuculose or 6-deoxy-tagatose is a ketohexose deoxy sugar.{{cite book |title=Essentials of Carbohydrate Chemistry and Biochemistry | first = Thisbe K. | last = Lindhorst | name-list-style = vanc |publisher=Wiley-VCH |edition=1 |year=2007 |isbn=978-3-527-31528-4}}{{cite book |title=Essentials of Carbohydrate Chemistry |publisher=Springer | first =John F. | last = Robyt | name-list-style = vanc | edition = 1st |year=1997 |isbn=0-387-94951-8}} Fuculose is involved in the process of sugar metabolism.{{cite journal | vauthors = Wen L, Zang L, Huang K, Li S, Wang R, Wang PG | title = Efficient enzymatic synthesis of L-rhamnulose and L-fuculose | journal = Bioorganic & Medicinal Chemistry Letters | volume = 26 | issue = 3 | pages = 969–972 | date = February 2016 | pmid = 26778148 | pmc = 5984655 | doi = 10.1016/j.bmcl.2015.12.051 }} {{sm|l}}-Fuculose can be formed from Fucose by L-fucose isomerase and converted to L-fuculose-1-phosphate by L-fuculokinase.{{cite journal |last1=Iqbal |first1=Muhammad Waheed |display-authors=etal |title=A review on selective l-fucose/d-arabinose isomerases for biocatalytic production of l-fuculose/d-ribulose |journal=International Journal of Biological Macromolecules |volume=168 |year=2021 |pages=558–571 |doi=10.1016/j.ijbiomac.2020.12.021 |pmid=33296692|s2cid=228088451 }}