GSK-598809
{{Short description|An experimental selective dopamine D3 receptor antagonist}}
{{Infobox drug
| drug_name =
| image = GSK-598809.svg
| width =
| caption =
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| licence_CA =
| licence_EU =
| DailyMedID =
| licence_US =
| pregnancy_AU =
| pregnancy_category =
| dependency_liability =
| addiction_liability =
| routes_of_administration =
| class = Dopamine D3 receptor antagonist
| ATC_prefix =
| ATC_suffix =
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action =
| excretion =
| CAS_number = 863680-46-0
| CAS_supplemental =
| PubChem = 11784937
| IUPHAR_ligand =
| DrugBank =
| ChemSpiderID = 32701679
| UNII = Y5OZ63HC3V
| KEGG =
| ChEBI =
| ChEMBL = 3590085
| NIAID_ChemDB =
| PDB_ligand =
| synonyms = GSK598809
| IUPAC_name = 5-[5-[3-[(1S,5R)-1-[2-fluoro-4-(trifluoromethyl)phenyl]-3-azabicyclo[3.1.0]hexan-3-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-4-methyl-1,3-oxazole
| C=22 | H=23 | F=4 | N=5 | O=1 | S=1
| SMILES = CC1=C(OC=N1)C2=NN=C(N2C)SCCCN3C[C@@H]4C[C@@]4(C3)C5=C(C=C(C=C5)C(F)(F)F)F
| StdInChI = 1S/C22H23F4N5OS/c1-13-18(32-12-27-13)19-28-29-20(30(19)2)33-7-3-6-31-10-15-9-21(15,11-31)16-5-4-14(8-17(16)23)22(24,25)26/h4-5,8,12,15H,3,6-7,9-11H2,1-2H3/t15-,21-/m0/s1
| StdInChIKey = ZKRWPAYTJMRKLJ-BTYIYWSLSA-N
}}
GSK-598809 is a selective dopamine D3 receptor antagonist that is or was under development for the treatment of substance-related disorders, smoking withdrawal, and eating disorders like binge eating disorder.{{cite web | title=GSK 598809 | website=AdisInsight | date=1 August 2023 | url=https://adisinsight.springer.com/drugs/800025964 | access-date=25 September 2024}}{{cite journal | vauthors = Pich EM, Collo G | title = Pharmacological targeting of dopamine D3 receptors: Possible clinical applications of selective drugs | journal = Eur Neuropsychopharmacol | volume = 25 | issue = 9 | pages = 1437–1447 | date = September 2015 | pmid = 26298833 | doi = 10.1016/j.euroneuro.2015.07.012 | url = }}{{cite book | vauthors = Newman AH, Xi ZX, Heidbreder C | title = Therapeutic Applications of Dopamine D3 Receptor Function | chapter = Current Perspectives on Selective Dopamine D3 Receptor Antagonists/Partial Agonists as Pharmacotherapeutics for Opioid and Psychostimulant Use Disorders | series = Current Topics in Behavioral Neurosciences | volume = 60 | issue = | pages = 157–201 | date = 2023 | pmid = 35543868 | pmc = 9652482 | doi = 10.1007/7854_2022_347 | isbn = 978-3-031-23057-8 | chapter-url = }}
The drug is highly selective for the dopamine D3 receptor (Ki = 6.2{{nbsp}}nM) over the dopamine D2 receptor (Ki = 740{{nbsp}}nM) (~120-fold preference for the D3 receptor over the D2 receptor). A single dose of GSK-598809 achieved 72 to 89% occupancy of the D3 receptor in smokers.
Side effects of GSK-598809 in clinical trials have included headache and somnolence with no sedation or extrapyramidal symptoms. This is in contrast to dopamine D2 receptor antagonists, which are associated with sedation, motor side effects, reduced activity, and emotional blunting. However, GSK-598809 has been associated with cardiovascular side effects at high doses. It increases blood pressure in animals and this effect was especially strong in the presence of cocaine, which dampened enthusiasm for its clinical development for cocaine use disorder. However, other more recently developed and selective D3 receptor antagonists like (R)-VK4-116 and (R)-VK4-40 do not share these cardiovascular side effects.
GSK-598809 was first described in the scientific literature by 2009.{{cite journal | vauthors = Kenny PJ | title = Emerging therapeutic targets for the treatment of nicotine addiction | journal = Expert Rev Clin Pharmacol | volume = 2 | issue = 3 | pages = 221–225 | date = May 2009 | pmid = 24410700 | doi = 10.1586/ecp.09.6 | url = }}{{cite journal | vauthors = Xi ZX, Spiller K, Gardner EL | title = Mechanism-based medication development for the treatment of nicotine dependence | journal = Acta Pharmacol Sin | volume = 30 | issue = 6 | pages = 723–739 | date = June 2009 | pmid = 19434058 | pmc = 3713229 | doi = 10.1038/aps.2009.46 | url = }} As of August 2023, no recent development of GSK-598809 has been reported for substance-related disorders, smoking withdrawal, or eating disorders since July 2016. GSK-598809 reached at least phase 1 clinical trials. According to a 2021 review, the clinical effects of GSK-598809 and other experimental dopamine D3 receptor antagonists were mixed or unsatisfactory and thus their development was discontinued early into clinical trials.{{cite journal | vauthors = Kiss B, Laszlovszky I, Krámos B, Visegrády A, Bobok A, Lévay G, Lendvai B, Román V | title = Neuronal Dopamine D3 Receptors: Translational Implications for Preclinical Research and CNS Disorders | journal = Biomolecules | volume = 11 | issue = 1 | date = January 2021 | page = 104 | pmid = 33466844 | pmc = 7830622 | doi = 10.3390/biom11010104 | doi-access = free | url = }} In any case, signs of clinical efficacy were reported to have been observed.
See also
References
{{Reflist}}
{{Dopamine receptor modulators}}