Hexestrol dicaprylate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [4-[4-(4-Octanoyloxyphenyl)hexan-3-yl]phenyl] octanoate

| image = Hexestrol dicaprylate.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 20305-51-5

| CAS_supplemental =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = J9DFR4IT9Z

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 161308

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 141698

| KEGG =

| ChEBI =

| ChEMBL =

| C=34 | H=50 | O=4

| smiles = CCCCCCCC(=O)OC1=CC=C(C=C1)C(CC)C(CC)C2=CC=C(C=C2)OC(=O)CCCCCCC

| StdInChI_Ref =

| StdInChI = InChI=1S/C34H50O4/c1-5-9-11-13-15-17-33(35)37-29-23-19-27(20-24-29)31(7-3)32(8-4)28-21-25-30(26-22-28)38-34(36)18-16-14-12-10-6-2/h19-26,31-32H,5-18H2,1-4H3

| StdInChIKey_Ref =

| StdInChIKey = JZMCTYYCJNIOBO-UHFFFAOYSA-N

| synonyms =

}}

Hexestrol dicaprylate (brand name Taston), or dioctanoylhexestrol, is a synthetic, nonsteroidal estrogen of the stilbestrol group related to diethylstilbestrol that is no longer marketed.{{cite book|author=J. Elks|title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA163|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=163–}}{{cite book|title=World Pharmaceuticals Directory|url=https://books.google.com/books?id=AiNtAAAAMAAJ|year=1988|publisher=Unlisted Drugs}} It is a long-acting{{cite journal | vauthors = Ono H, Miura T, Mizoguchi J, Imamichi T | title = Inhibitory effect and its recovery in the gonadal system of adult male rats by single injection with the long-lasting reproductive inhibitor, hexestrol dicaprylate | journal = Nippon Juigaku Zasshi | volume = 39 | issue = 4 | pages = 437–43 | year = 1977 | pmid = 916475 | doi = 10.1292/jvms1939.39.437| doi-access = free }} ester of hexestrol.