Hexestrol diphosphate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [4-[(3S,4R)-4-(4-phosphonooxyphenyl)hexan-3-yl]phenyl] dihydrogen phosphate

| image = Hexestrol diphosphate.svg

| width =

| tradename = Cytostatin, Cytostesin, Pharmestrin, Retalon Aquosum

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Intravenous injection

| class = Estrogen; Nonsteroidal estrogen

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 24809-02-7

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| PubChem = 193055

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 167536

| ChEMBL = 1162236

| UNII = 30L14W008X

| synonyms = DA-268; NSC-35752

| C=18 | H=24 | O=8 | P=2

| SMILES = CCC(C1=CC=C(C=C1)OP(=O)(O)O)C(CC)C2=CC=C(C=C2)OP(=O)(O)O

| StdInChI_Ref =

| StdInChI = 1S/C18H24O8P2/c1-3-17(13-5-9-15(10-6-13)25-27(19,20)21)18(4-2)14-7-11-16(12-8-14)26-28(22,23)24/h5-12,17-18H,3-4H2,1-2H3,(H2,19,20,21)(H2,22,23,24)/t17-,18+

| StdInChIKey_Ref =

| StdInChIKey = JBDIWCWZUDNWTL-HDICACEKSA-N

}}

Hexestrol diphosphate (brand names Cytostatin, Cytostesin, Pharmestrin, Retalon Aquosum) is a synthetic, nonsteroidal estrogen of the stilbestrol group related to diethylstilbestrol and used as an estrogen and antineoplastic agent in the treatment of prostate cancer.{{cite book | doi = 10.1007/978-1-4757-2085-3 | chapter-url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=RA1-PA129 | title=The Dictionary of Drugs | chapter = Chemical Data, Structures and Bibliographies | publisher=Springer | date=14 November 2014 | vauthors = Elks J | veditors = Ganellin J, Elks J | page=163 | isbn=978-1-4757-2085-3 | oclc=898564124}}{{cite book| vauthors = Milne GW |title=Drugs: Synonyms and Properties: Synonyms and Properties|url=https://books.google.com/books?id=xUlaDwAAQBAJ&pg=PT1408|date=8 May 2018|publisher=Taylor & Francis|isbn=978-1-351-78989-9|pages=1408–}}{{cite journal | vauthors = Adami E, Marazzi-Uberti E | title = [Experimental research on prostatic antineoplastic agent: hexestrol diphosphate] | language = Italian | journal = Giornale Italiano di Chemioterapia | volume = 3 | issue = 3–4 | pages = 362–9 | date = July–December 1956 | pmid = 13462184 | issn = 0017-0445 }} It is a water-soluble ester of hexestrol. The medication has been known since at least 1956.