Hippulin

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (13S,14R)-3-hydroxy-13-methyl-7,11,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-one

| image = Hippulin.svg

| width = 225px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = By mouth

| class = Estrogen

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 474-87-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7C1N8RKG9F

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 6451472

| ChemSpiderID = 4953937

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| KEGG =

| ChEBI =

| ChEMBL =

| synonyms = Δ⁸-14-Isoestrone; 8-Dehydro-14-isoestrone; 14-Isoestra-1,3,5(10),8-tetraen-3-ol-17-one

| C=18 | H=20 | O=2

| SMILES = C[C@]12CCC3=C([C@@H]1CCC2=O)CCc4c3ccc(c4)O

| StdInChI = 1S/C18H20O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,16,19H,2,4,6-9H2,1H3/t16-,18-/m0/s1

| StdInChIKey = OUGSRCWSHMWPQE-WMZOPIPTSA-N

}}

Hippulin, also known as Δ⁸-14-isoestrone, as well as 14-isoestra-1,3,5(10),8-tetraen-3-ol-17-one, is a naturally occurring estrogen found in horses and an isomer of equilin.{{cite book|author=C. W. Emmens|title=Hormone Assay|url=https://books.google.com/books?id=cCzgBAAAQBAJ&pg=PA391|date=22 October 2013|publisher=Elsevier Science|isbn=978-1-4832-7286-3|pages=391–}}{{cite book|author=H.J. Buchsbaum|title=The Menopause|url=https://books.google.com/books?id=z0LuBwAAQBAJ&pg=PA56|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-1-4612-5525-3|pages=56–}}{{cite journal | vauthors = Banes D, Carol J, Haenni EO | title = The resolution of isoequilin A and the identification of compound 3 | journal = J. Biol. Chem. | volume = 187 | issue = 2 | pages = 557–70 | year = 1950 | doi = 10.1016/S0021-9258(18)56200-1 | pmid = 14803438 | url = http://www.jbc.org/content/187/2/557.full.pdf| doi-access = free }}Girard, H., Sandulesco, G., Fridenson, A., Gaudefroy, C., & Rutgers, J. J. (1932). Sur les Hormones Sexuelles Cristallisées Retirées de l'Urine des Juments Gravides. Compt. Rend. Acad. Sci, 194, 1020. The compound, likely in sodium sulfate form, is a component of conjugated estrogens (Premarin), a pharmaceutical extract of the urine of pregnant mares, though it is present only in small amounts in pregnant mare urine.{{cite journal|last1=Wintersteiner|first1=O.|title=Estrogenic Diols from the Urine of Pregnant Mares|journal=Cold Spring Harbor Symposia on Quantitative Biology|volume=5|year=1937|pages=25–33|issn=0091-7451|doi=10.1101/SQB.1937.005.01.003|s2cid=81202266 }} It has been reported by possess either equivalent estrogenic activity to that of equilin or only slight estrogenic activity. The compound was first described in 1932.