Homofentanyl

{{Short description|Opioid designer drug}}

{{drugbox

| drug_name = Homofentanyl

| image = Homofentanyl.svg

| image_class = skin-invert-image

| image2 = Homofentanyl 3D BS.png

| image_class2 = bg-transparent

| legal_UK =

| legal_DE =

| C = 23 | H = 30 | N = 2 | O = 1

| IUPAC_name = N-phenyl-N-[1-(3-phenylpropyl)piperidin-4-yl]propanamide

| CAS_number = 59708-54-2

| CAS_supplemental =
117332-88-4 (HCl)

| ChemSpiderID =

| PubChem = 618626

| UNII = GBD33DI2IP

| smiles = CCC(=O)N(C1CCN(CC1)CCCC2=CC=CC=C2)C3=CC=CC=C3

| StdInChI = 1S/C23H30N2O/c1-2-23(26)25(21-13-7-4-8-14-21)22-15-18-24(19-16-22)17-9-12-20-10-5-3-6-11-20/h3-8,10-11,13-14,22H,2,9,12,15-19H2,1H3

| StdInChIKey = CKBFKWWOUYBCRH-UHFFFAOYSA-N

}}

Homofentanyl (N-Phenylpropylnorfentanyl, Fentanyl propyl analogue) is an opioid derivative which has been sold as a designer drug. It is a homologue of fentanyl, with similar analgesic and sedative effects but lower potency,{{cite journal | vauthors = Cooper D, Jacob M, Allen A | title = Identification of fentanyl derivatives | journal = Journal of Forensic Sciences | volume = 31 | issue = 2 | pages = 511–28 | date = April 1986 | pmid = 3711827 | doi = 10.1520/JFS12283J }}{{cite web | url = https://www.incb.org/documents/Global_Projects_OPIOIDS/INCB.GRIDS.OPIOIDS.Fentanyl-Rel_Subs_list.pdf | title = Fentanyl-Related Substances with no Currently Known Legitimate Uses. | work = International Narcotics Control Board (INCB) | date = 15 September 2020 }} around 14× stronger than pethidine.{{cite book | vauthors = Casy AF, Parfitt RY | title = Opioid analgesics, chemistry and receptors | date = 1986 | publisher = Plenum Press | location = New York | pages = 289 | isbn = 978-0-306-42130-3 }}

See also

References

{{reflist}}

{{Opioids}}

Category:Designer drugs

Category:Opioids

{{analgesic-stub}}