Secofentanyl
{{Short description|Chemical compound}}
{{drugbox
| drug_name = Secofentanyl
| image = Secofentanyl.svg
| image_class = skin-invert-image
| legal_UK =
| legal_DE =
| C = 22 | H = 30 | N = 2 | O = 1
| IUPAC_name = N-[4-[methyl(2-phenylethyl)amino]butan-2-yl]-N-phenylpropanamide
| CAS_number = 253342-66-4
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = DGK2A2KAN8
| CAS_supplemental =
| ChemSpiderID =
| PubChem = 11724725
| smiles = CCC(=O)N(C1=CC=CC=C1)C(C)CCN(C)CCC2=CC=CC=C2
| StdInChI = 1S/C22H30N2O/c1-4-22(25)24(21-13-9-6-10-14-21)19(2)15-17-23(3)18-16-20-11-7-5-8-12-20/h5-14,19H,4,15-18H2,1-3H3
| StdInChIKey = TVSLDWMMAUJGPV-UHFFFAOYSA-N
}}
Secofentanyl is an opioid derivative which is an analogue of fentanyl where the piperidine ring has been cleaved to form an open-chain structure. It is around 40× less potent than fentanyl itself but still 5–6× the potency of morphine in animal tests.{{cite journal | vauthors = Ivanović MD, Mićović I, Vučković S, Prostran M, Todorović Z, Ivanović E, Kiricojević V, Đorđević JB, Došen-Mićović L | title = The synthesis and pharmacological evaluation of (+/-)-2, 3-seco-fentanyl analogues. | journal = Journal of the Serbian Chemical Society | date = 2004 | volume = 69 | issue = 11 | pages = 955–68 | doi = 10.2298/JSC0411955I | doi-access = free }}{{cite journal | vauthors = Lipiński PF, Kosson P, Matalińska J, Roszkowski P, Czarnocki Z, Jarończyk M, Misicka A, Dobrowolski JC, Sadlej J | title = Fentanyl Family at the Mu-Opioid Receptor: Uniform Assessment of Binding and Computational Analysis | journal = Molecules (Basel, Switzerland) | volume = 24 | issue = 4 | date = February 2019 | page = 740 | pmid = 30791394 | pmc = 6412969 | doi = 10.3390/molecules24040740 | doi-access = free }}