Hydroxytertatolol

{{short description|Chemical compound}}

{{Infobox drug

| drug_name =

| IUPAC_name = 8-{2-Hydroxy-3-[(2-methyl-2-propanyl)amino]propoxy}-4-thiochromanol

| image = 4-Hydroxytertatolol.svg

| alt =

| caption =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 111897-93-9

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = RKM76FBC3F

| ATCvet =

| ATC_prefix = None

| ATC_suffix =

| PubChem = 163871

| ChemSpiderID = 143721

| DrugBank =

| synonyms = 4-Hydroxytertatolol

| C=16 | H=25 | N=1 | O=3 | S=1

| smiles = OC(CNC(C)(C)C)COc2cccc1c2SCCC1O

| StdInChI = 1S/C16H25NO3S/c1-16(2,3)17-9-11(18)10-20-14-6-4-5-12-13(19)7-8-21-15(12)14/h4-6,11,13,17-19H,7-10H2,1-3H3

| StdInChIKey = RVGKVEPDZHPSBE-UHFFFAOYSA-N

}}

Hydroxytertatolol is a beta blocker.{{cite journal | journal = Journal of Liquid Chromatography | volume = 18 | issue =14 | year = 1995 | title = Determination of 4-Hydroxytertatolol Stereoisomers in Rat and Human Urine by High-Performance Liquid Chromatography | doi = 10.1080/10826079508009325 | vauthors = Lave T, Efthymiopoulos C, Christmann D, Koffel JC, Jung L | pages = 2801–2812}}{{cite journal | vauthors = Bastian G, Urien S, Brée F, Jolliet P, Rocher I, Crambes O, Tillement JP | title = Stereoselective binding of tertatolol and of 4-hydroxytertatolol to human plasma proteins | journal = European Journal of Drug Metabolism and Pharmacokinetics | volume = 17 | issue = 3 | pages = 233–236 | year = 1992 | pmid = 1362702 | doi = 10.1007/bf03190151 | s2cid = 28632918 }} It is a derivative of tertatolol.