tertatolol

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 408926545

| IUPAC_name = (±)-1-(tert-Butylamino)-3-(3,4-dihydro-2H-thiochromen-8-yloxy)propan-2-ol

| image = Tertatolol.svg

| chirality = Racemic mixture

| tradename =

| Drugs.com = {{drugs.com|international|tertatolol}}

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 83688-84-0

| ATC_prefix = C07

| ATC_suffix = AA16

| PubChem = 36920

| IUPHAR_ligand = 571

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 9ZO341YQXP

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07182

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 434200

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 33875

| C=16 | H=25 | N=1 | O=2 | S=1

| smiles = CC(C)(C)NCC(COC1=CC=CC2=C1SCCC2)O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C16H25NO2S/c1-16(2,3)17-10-13(18)11-19-14-8-4-6-12-7-5-9-20-15(12)14/h4,6,8,13,17-18H,5,7,9-11H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = HTWFXPCUFWKXOP-UHFFFAOYSA-N

}}

Tertatolol (Artex, Artexal, Prenalex) is a medication in the class of beta blockers, used in the treatment of high blood pressure. It was discovered by the French pharmaceutical company Servier and is marketed in Europe.{{cite book | author = Swiss Pharmaceutical Society | title = Index Nominum 2000: International Drug Directory (Book with CD-ROM) | publisher = Medpharm Scientific Publishers | location = Boca Raton | year = 2000 | isbn = 3-88763-075-0 | url = https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA1002}}

Tertatolol has also been shown to act as a serotonin 5-HT_1A and 5-HT_1B receptor antagonist, similarly to propranolol and pindolol.{{cite journal | vauthors = Langlois M, Brémont B, Rousselle D, Gaudy F | title = Structural analysis by the comparative molecular field analysis method of the affinity of beta-adrenoreceptor blocking agents for 5-HT1A and 5-HT1B receptors | journal = European Journal of Pharmacology | volume = 244 | issue = 1 | pages = 77–87 | date = January 1993 | pmid = 8093601 | doi = 10.1016/0922-4106(93)90061-d }}{{cite journal | vauthors = Jolas T, Haj-Dahmane S, Lanfumey L, Fattaccini CM, Kidd EJ, Adrien J, Gozlan H, Guardiola-Lemaitre B, Hamon M | display-authors = 6 | title = (-)Tertatolol is a potent antagonist at pre- and postsynaptic serotonin 5-HT1A receptors in the rat brain | journal = Naunyn-Schmiedeberg's Archives of Pharmacology | volume = 347 | issue = 5 | pages = 453–463 | date = May 1993 | pmid = 7686633 | doi = 10.1007/bf00166735 | s2cid = 22129922 }}{{cite book | vauthors = van Wijngaarden I, Soudijn W, Tulp MT | chapter = 5-HT_1A Receptors | veditors = Soudijn W, Olivier B, van Wijngaarden I | title = Serotonin Receptors and Their Ligands | publisher = Elsevier | location = Amsterdam | year = 1997 | isbn = 0-444-82041-8 | chapter-url = https://books.google.com/books?id=lfo0hGqIex0C&pg=PA37}}