Imazapyr

{{Refimprove|date=July 2019}}

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 433109364

| ImageFile=Imazapyr.png

| ImageSize=200px

| IUPACName=(RS)-2-(4-Methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3-carboxylic acid

| OtherNames=

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=81334-34-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 787MX0M5A6

| PubChem=54738

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 82021

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = C18864

| SMILES=OC(C1=C(C(N2)=NC(C)(C(C)C)C2=O)N=CC=C1)=O

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 49445

| InChI = 1/C13H15N3O3/c1-7(2)13(3)12(19)15-10(16-13)9-8(11(17)18)5-4-6-14-9/h4-7H,1-3H3,(H,17,18)(H,15,16,19)

| InChIKey = CLQMBPJKHLGMQK-UHFFFAOYAH

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C13H15N3O3/c1-7(2)13(3)12(19)15-10(16-13)9-8(11(17)18)5-4-6-14-9/h4-7H,1-3H3,(H,17,18)(H,15,16,19)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = CLQMBPJKHLGMQK-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=13 | H=15 | N=3 | O=3

| Appearance=

| Density= 1,34

| MeltingPt= 169-171

| BoilingPt=

| Solubility=13.47 g/L

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

{{Copyvio|timestamp=20250530001038 |url=https://web.archive.org/web/20160423032526/http://www.toku-e.com/Upload/Products/PDS/20120517005192.pdf}}

Imazapyr is a non-selective herbicide used for the control of a broad range of weeds including terrestrial annual and perennial grasses and broadleaved herbs, woody species, and riparian and emergent aquatic species.[http://envirocancer.cornell.edu/turf/pdf/Imazapyr_RED.pdf Reregistration Eligibility Decision for Imazapyr], U.S. Environmental Protection Agency It is used to control annual and perennial grass and broadleaved weeds, brush, vines and many deciduous trees. Imazapyr is absorbed by the leaves and roots, and moves rapidly through the plant. It accumulates in the meristem region (active growth region) of the plant. In plants, imazapyr disrupts protein synthesis and interferes with cell growth and DNA synthesis.{{cite web|title=Imazapyr Product Data Sheet |url=http://www.toku-e.com/Upload/Products/PDS/20120517005192.pdf |website=TOKU-E |date=October 10, 2011 |archive-url=https://web.archive.org/web/20160423032526/http://www.toku-e.com/Upload/Products/PDS/20120517005192.pdf |archive-date=April 23, 2016}}