Inosine triphosphate

{{chembox

| ImageFile = Inosine triphosphate Haworth.svg

| ImageSize = 200

| ImageAlt = 2D Molecular Structure of Inosine Triphosphate

| IUPACName = Inosine 5′-(tetrahydrogen triphosphate)

| SystematicName = O¹-{[(2R,3S,4R,5R)-3,4-Dihydroxy-5-(6-oxo-1,6-dihydro-9H-purin-9-yl)oxolan-2-yl]methyl} tetrahydrogen triphosphate

| OtherNames = iniosine triphosphate

| Section1 = {{Chembox Identifiers

| CASNo = 132-06-9

| CASNo_Ref = {{Cascite|changed|CAS}}

| ChEBI = 16039

| ChEMBL = 1233686

| ChemSpiderID = 8265

| EINECS = 205-046-7

| KEGG = C00081

| UNII = 212A76R77X

| InChIKey = HAEJPQIATWHALX-KQYNXXCUSA-N

| PubChem = 135398643

| SMILES = C1=NC(=O)C2=C(N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O

}}

| Section2 = {{Chembox Properties

| C=10|H=15|N=4|O=14|P=3

| Solubility = 903.5 mg/mL

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Inosine triphosphate (ITP) is an intermediate in the purine metabolism pathway, seen in the synthesis of ATP and GTP. It comprises an inosine nucleotide containing three phosphate groups esterified to the sugar moiety.

ITP results from deamination of ATP. Incorporation of ITP into the DNA from the nucleotide pool can lead to DNA damage, mutagenesis and other harmful effects.{{cite journal | vauthors = Ji D, Stepchenkova EI, Cui J, Menezes MR, Pavlov YI, Kool ET | title = Measuring deaminated nucleotide surveillance enzyme ITPA activity with an ATP-releasing nucleotide chimera | journal = Nucleic Acids Research | volume = 45 | issue = 20 | pages = 11515–11524 | date = November 2017 | pmid = 29036687 | pmc = 5714213 | doi = 10.1093/nar/gkx774 }} ITP is processed by the enzyme inosine triphosphate pyrophosphatase (ITPA), which turns it into inosine monophosphate (IMP), to avoid incorporation into DNA.