JTE-907
{{Short description|Chemical compound}}
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 445945676
| IUPAC_name = N-(benzo[1,3]dioxol-5-ylmethyl)-7-methoxy-2-oxo-8-pentyloxy-1,2-dihydroquinoline-3-carboxamide
| image = JTE-907 Structure.svg
| image_class = skin-invert-image
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA = Schedule II
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 282089-49-0
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = DAV3Q7SNOL
| ATC_prefix =
| ATC_suffix =
| PubChem = 9867770
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID = 8043461
| chemical_formula =
| C=24 | H=26 | N=2 | O=6
| smiles = c4c3OCOc3ccc4CNC(=O)c(cc2ccc1OC)c(=O)[nH]c2c1OCCCCC
| StdInChI = 1S/C24H26N2O6/c1-3-4-5-10-30-22-19(29-2)9-7-16-12-17(24(28)26-21(16)22)23(27)25-13-15-6-8-18-20(11-15)32-14-31-18/h6-9,11-12H,3-5,10,13-14H2,1-2H3,(H,25,27)(H,26,28)
| StdInChIKey = GRAJFFFXJYFVOC-UHFFFAOYSA-N
}}
JTE-907 is a drug used in scientific research that acts as a selective CB2 inverse agonist.{{cite journal | vauthors = Iwamura H, Suzuki H, Ueda Y, Kaya T, Inaba T | title = In vitro and in vivo pharmacological characterization of JTE-907, a novel selective ligand for cannabinoid CB2 receptor | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 296 | issue = 2 | pages = 420–5 | date = February 2001 | pmid = 11160626 }}{{cite journal | vauthors = Raitio KH, Savinainen JR, Vepsäläinen J, Laitinen JT, Poso A, Järvinen T, Nevalainen T | title = Synthesis and SAR studies of 2-oxoquinoline derivatives as CB2 receptor inverse agonists | journal = Journal of Medicinal Chemistry | volume = 49 | issue = 6 | pages = 2022–7 | date = March 2006 | pmid = 16539390 | doi = 10.1021/jm050879z }} It has antiinflammatory effects in animal studies,{{cite journal | vauthors = Ueda Y, Miyagawa N, Matsui T, Kaya T, Iwamura H | title = Involvement of cannabinoid CB(2) receptor-mediated response and efficacy of cannabinoid CB(2) receptor inverse agonist, JTE-907, in cutaneous inflammation in mice | journal = European Journal of Pharmacology | volume = 520 | issue = 1–3 | pages = 164–71 | date = September 2005 | pmid = 16153638 | doi = 10.1016/j.ejphar.2005.08.013 }} thought to be mediated by an interaction between the CB2 receptor and IgE.{{cite journal | vauthors = Ueda Y, Miyagawa N, Wakitani K | title = Involvement of cannabinoid CB2 receptors in the IgE-mediated triphasic cutaneous reaction in mice | journal = Life Sciences | volume = 80 | issue = 5 | pages = 414–9 | date = January 2007 | pmid = 17055000 | doi = 10.1016/j.lfs.2006.09.026 }}