JTE 7-31

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 453317265

| ImageFile = JTE_7-31 Structure.svg

| ImageClass = skin-invert-image

| ImageSize = 220px

| PIN = 2-[2-(4-Hydroxyphenyl)ethyl]-5-methoxy-4-(pentylamino)-2,3-dihydro-1H-isoindol-1-one

| OtherNames =

| Section1 = {{Chembox Identifiers

| Abbreviations =

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 194358-72-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7MV5OX2NX0

| EINECS =

| PubChem = 19363402

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 13767708

| SMILES = Oc1ccc(cc1)CCN3Cc2c(ccc(OC)c2NCCCCC)C3=O

| InChI = 1/C22H28N2O3/c1-3-4-5-13-23-21-19-15-24(14-12-16-6-8-17(25)9-7-16)22(26)18(19)10-11-20(21)27-2/h6-11,23,25H,3-5,12-15H2,1-2H3

| InChIKey = FMUMUYFMLZGXJR-UHFFFAOYAA

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C22H28N2O3/c1-3-4-5-13-23-21-19-15-24(14-12-16-6-8-17(25)9-7-16)22(26)18(19)10-11-20(21)27-2/h6-11,23,25H,3-5,12-15H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = FMUMUYFMLZGXJR-UHFFFAOYSA-N

| RTECS =

| MeSHName =

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI =

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG =

}}

| Section2 = {{Chembox Properties

| Formula = C₂₂H₂₈N₂O₃

| MolarMass = 368.469 g/mol

| Appearance =

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility =

| SolubleOther =

| Solvent =

| pKa =

| pKb =

}}

|Section7 = {{Chembox Hazards

| ExternalSDS =

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| PEL =

}}

}}

JTE 7-31 is a selective cannabinoid receptor agonist invented by Japan Tobacco.{{Ref patent2 |country= WO |number= 1997/029079 |status= granted |title= Novel compounds and pharmaceutical use thereof |pubdate= 1997-31-07 |gdate= 1997-14-08 |pridate= 1997-06-02 |inventor =Inaba T, Kaya T, Iwamura H }}{{Ref patent2 |country = US |number= 6017919 |status= granted |title= Compounds and pharmaceutical use thereof |pubdate= 1998-08-06 |gdate= 2000-01-25 |pridate= 1998-08-06 |inventor= Inaba T, Kaya T, Iwamura H }} It is a reasonably highly selective CB₂ agonist, but still retains appreciable affinity at CB₁, with a K_i of 0.088nM at CB₂ vs 11nM at CB₁.{{cite journal | vauthors = Han S, Zhang FF, Qian HY, Chen LL, Pu JB, Xie X, Chen JZ | title = Design, syntheses, structure-activity relationships and docking studies of coumarin derivatives as novel selective ligands for the CB2 receptor | journal = European Journal of Medicinal Chemistry | volume = 93 | issue = | pages = 16–32 | date = March 2015 | pmid = 25644673 | doi = 10.1016/j.ejmech.2015.01.054 }}