Leniolisib
{{Short description|Medication}}
{{Use American English|date=March 2023}}
{{Use dmy dates|date=March 2023}}
{{cs1 config |name-list-style=vanc |display-authors=6}}
{{Infobox drug
| image = Leniolisib.svg
| width =
| alt =
| caption =
| pronounce =
| tradename = Joenja
| Drugs.com = {{drugs.com|monograph|leniolisib}}
| MedlinePlus = a623016
| DailyMedID = Leniolisib
| pregnancy_AU =
| pregnancy_AU_comment =
| pregnancy_category =
| routes_of_administration = By mouth
| class = Antineoplastic
| ATCvet =
| ATC_prefix = L03
| ATC_suffix = AX22
| ATC_supplemental =
| legal_AU = S4
| legal_BR =
| legal_BR_comment =
| legal_CA =
| legal_CA_comment =
| legal_DE =
| legal_DE_comment =
| legal_NZ =
| legal_NZ_comment =
| legal_UK =
| legal_UK_comment =
| legal_US = Rx-only
| legal_EU =
| legal_EU_comment =
| legal_UN =
| legal_UN_comment =
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action =
| excretion =
| index2_label = as salt
| CAS_number = 1354690-24-6
| CAS_number2 = 1354691-97-6
| CAS_supplemental =
| PubChem =
| IUPHAR_ligand =
| DrugBank = DB16217
| ChemSpiderID = 52083264
| UNII = L22772Z9CP
| KEGG = D11158
| KEGG2 = D11159
| ChEBI =
| ChEMBL = 3643413
| NIAID_ChemDB =
| PDB_ligand = 9NQ
| synonyms = CDZ173
| IUPAC_name =
| C = 21 | H = 25 | F = 3 | N = 6 | O = 2
| SMILES = CCC(=O)N1CC[C@@H](C1)NC1=C2CN(CCC2=NC=N1)C1=CN=C(OC)C(=C1)C(F)(F)F
| StdInChI = 1S/C21H25F3N6O2/c1-3-18(31)30-6-4-13(10-30)28-19-15-11-29(7-5-17(15)26-12-27-19)14-8-16(21(22,23)24)20(32-2)25-9-14/h8-9,12-13H,3-7,10-11H2,1-2H3,(H,26,27,28)/t13-/m0/s1
| StdInChI_comment =
| StdInChIKey = MWKYMZXCGYXLPL-ZDUSSCGKSA-N
| density =
| density_notes =
| melting_point =
| melting_high =
| melting_notes =
| boiling_point =
| boiling_notes =
| solubility =
| sol_units =
| specific_rotation =
}}
Leniolisib (INN{{cite journal | vauthors=((World Health Organization)) | title=International nonproprietary names for pharmaceutical substances (INN): recommended INN: list 76 | journal=WHO Drug Information | volume=30 | issue=3 | year=2016 | hdl=10665/331020 | hdl-access=free | author-link = World Health Organization }}{{cite journal | vauthors=((World Health Organization)) | title=International nonproprietary names for pharmaceutical substances (INN): recommended INN: list 77 | journal=WHO Drug Information | volume=31 | issue=1 | year=2017 | hdl=10665/330984 | hdl-access=free | author-link = World Health Organization }}), sold under the brand name Joenja, is a medication used for the treatment of activated phosphoinositide 3-kinase delta syndrome (APDS). It is a kinase inhibitor{{cite journal | vauthors = Duggan S, Al-Salama ZT | title = Leniolisib: First Approval | journal = Drugs | volume = 83 | issue = 10 | pages = 943–948 | date = July 2023 | pmid = 37256490 | doi = 10.1007/s40265-023-01895-4 | s2cid = 258989663 | url = https://figshare.com/articles/online_resource/Leniolisib_First_Approval/22944338 }} that is taken by mouth.
The most common side effects include headache, sinusitis, and atopic dermatitis.
Leniolisib was approved for medical use in the United States in March 2023.{{cite press release | title=FDA approves first treatment for activated phosphoinositide 3-kinase delta syndrome | website=U.S. Food and Drug Administration (FDA) | date=24 March 2023 | url=https://www.fda.gov/drugs/news-events-human-drugs/fda-approves-first-treatment-activated-phosphoinositide-3-kinase-delta-syndrome | archive-url=https://web.archive.org/web/20230325032642/https://www.fda.gov/drugs/news-events-human-drugs/fda-approves-first-treatment-activated-phosphoinositide-3-kinase-delta-syndrome | url-status=dead | archive-date=25 March 2023 | access-date=24 March 2023}} {{PD-notice}}{{cite news |title=US FDA approves Pharming's immune disorder drug |url=https://www.reuters.com/business/healthcare-pharmaceuticals/us-fda-approves-pharmings-immune-disorder-drug-2023-03-24/ |access-date=24 March 2023 |publisher=Reuters |archive-date=24 March 2023 |archive-url=https://web.archive.org/web/20230324190543/https://www.reuters.com/business/healthcare-pharmaceuticals/us-fda-approves-pharmings-immune-disorder-drug-2023-03-24/ |url-status=live }}{{cite press release | title=Pharming announces US FDA approval of Joenja (leniolisib) as the first and only treatment indicated for APDS | website=Pharming Group N.V. | date=24 March 2023 | url=https://www.pharming.com/sites/default/files/imce/Press%20releases/Leniolisib%20PDUFA%20Approval%20_EN_24MAR23.pdf | access-date=25 March 2023}} It is the first approved medication for the treatment of activated PI3K delta syndrome. The US Food and Drug Administration (FDA) considers it to be a first-in-class medication.{{cite report | title=New Drug Therapy Approvals 2023 | website=U.S. Food and Drug Administration (FDA) | date=January 2024 | url=https://www.fda.gov/media/175253/download | format=PDF | access-date=9 January 2024 | archive-url=https://web.archive.org/web/20240110032419/https://www.fda.gov/media/175253/download | archive-date=10 January 2024 | url-status=live }}
Medical uses
Leniolisib is indicated for the treatment of activated phosphoinositide 3-kinase delta syndrome (activated PI3K delta syndrome) in people twelve years of age and older.
Activated PI3K delta syndrome is caused by mutations in either of two genes, PIK3CD or PIK3R1, that regulate the maturation of white blood cells, especially B cells and T cells. This leads to a decrease in immune cells, which makes it difficult for people with activated PI3K delta syndrome to fight off bacterial and viral infections.
Mechanism of action
Leniolisib is a selective phosphoinositide 3-kinase inhibitor (PI3Kδ inhibitor), which means it blocks a form of the protein called phosphoinositide 3-kinase delta (PI3Kδ) that is overactive in activated PI3K delta syndrome. By inhibiting PI3Kδ, leniolisib helps normalize immune function as measured by a significant increase in number of immune response generating B cells and reduction in size of lymph nodes.
Adverse effects
The most common encountered adverse effects were headache, sinusitis, and atopic dermatitis.{{cite web | title=Joenja- leniolisib tablet, film coated | website=DailyMed | date=29 March 2023 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=eefbcef8-2130-4654-8f29-b58077e08212 | access-date=20 June 2023}}
History
Leniolisib was developed by Novartis and subsequently licensed to Pharming Group, a Dutch biotechnology company, in 2019.
The US Food and Drug Administration (FDA) evaluated the efficacy of leniolisib in the placebo-controlled portion of Study 2201 (NCT02435173), a twelve‑week blinded, randomized, placebo-controlled study of 31 participants twelve years of age and older with confirmed APDS-associated genetic PI3Kδ mutation, with a documented variant in either PIK3CD or PIK3R1.
The FDA granted the application for leniolisib orphan drug, priority review, and rare pediatric disease designations.
References
External links
- {{ClinicalTrialsGov|NCT02435173|Study of Efficacy of CDZ173 in Patients With APDS/PASLI}}
{{Immunostimulants}}
{{Portal bar | Medicine}}
{{Authority control}}