Lodoxamide

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 407540115

| ImageFile=Lodoxamide.svg

| ImageSize=200px

| PIN=N,N′-(2-Chloro-5-cyano-1,3-phenylene)dioxamic acid

| OtherNames=

|Section1={{Chembox Identifiers

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = SPU695OD73

| DrugBank = DB06794

| CASNo_Ref = {{cascite|correct|??}}

| CASNo=53882-12-5

| PubChem=44564

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1201266

| SMILES = N#Cc1cc(NC(=O)C(=O)O)c(Cl)c(NC(=O)C(=O)O)c1

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 40543

| InChI = 1/C11H6ClN3O6/c12-7-5(14-8(16)10(18)19)1-4(3-13)2-6(7)15-9(17)11(20)21/h1-2H,(H,14,16)(H,15,17)(H,18,19)(H,20,21)

| InChIKey = RVGLGHVJXCETIO-UHFFFAOYAZ

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C11H6ClN3O6/c12-7-5(14-8(16)10(18)19)1-4(3-13)2-6(7)15-9(17)11(20)21/h1-2H,(H,14,16)(H,15,17)(H,18,19)(H,20,21)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = RVGLGHVJXCETIO-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=11 | H=6 | Cl=1 | N=3 | O=6

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section6={{Chembox Pharmacology

| ATCCode_prefix = S01

| ATCCode_suffix = GX05

}}

|Section7={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Lodoxamide is an antiallergic pharmaceutical drug. It is marketed under the tradename Alomide in the UK. Like cromoglicic acid it acts as a mast cell stabilizer.{{Cite journal

| doi = 10.1016/S0161-6420(00)00089-0

| last1 = Avunduk | first1 = A. M.

| last2 = Avunduk | first2 = M. C.

| last3 = Kapicioglu | first3 = Z.

| last4 = Akyol | first4 = N.

| last5 = Tavli | first5 = L.

| title = Mechanisms and comparison of anti-allergic efficacy of topical lodoxamide and cromolyn sodium treatment in vernal keratoconjunctivitis

| journal = Ophthalmology

| volume = 107

| issue = 7

| pages = 1333–1337

| year = 2000

| pmid = 10890862

}} In 2014 lodoxamide and bufrolin were found to be potent agonists at the G protein-coupled receptor 35, an orphan receptor believed to play a role in inflammatory processes, pain and the development of stomach cancer.{{cite journal | last=MacKenzie | first=AE | last2=Caltabiano | first2=G | last3=Kent | first3=TC | last4=Jenkins | first4=L | last5=McCallum | first5=JE | last6=Hudson | first6=BD | last7=Nicklin | first7=SA | last8=Fawcett | first8=L | last9=Markwick | first9=R | last10=Charlton | first10=SJ | last11=Milligan | first11=G | title=The antiallergic mast cell stabilizers lodoxamide and bufrolin as the first high and equipotent agonists of human and rat GPR35. | journal=Molecular Pharmacology | volume=85 | issue=1 | year=2014 | issn=0026-895X | pmid=24113750 | pmc=3868900 | doi=10.1124/mol.113.089482 | pages=91–104}}

See also

References