MMDA-3a

{{Infobox drug

| drug_name =

| image = MMDA-3a.svg

| width =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class = Serotonergic psychedelic; Hallucinogen

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 23693-19-8

| CAS_supplemental =

| PubChem = 90967

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 82148

| UNII = NY37N4M4KW

| KEGG =

| ChEBI =

| ChEMBL = 127603

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = 2-Methoxy-3,4-methylenedioxyamphetamine; 2-Methoxy-MDA; 2-MeO-MDA

| IUPAC_name = 1-(4-methoxy-1,3-benzodioxol-5-yl)propan-2-amine

| C=11 | H=15 | N=1 | O=3

| SMILES = CC(CC1=C(C2=C(C=C1)OCO2)OC)N

| StdInChI = 1S/C11H15NO3/c1-7(12)5-8-3-4-9-11(10(8)13-2)15-6-14-9/h3-4,7H,5-6,12H2,1-2H3

| StdInChIKey = OSJXZWMDUMAITM-UHFFFAOYSA-N

}}

MMDA-3a, also known as 2-methoxy-3,4-methylenedioxyamphetamine or as 2-methoxy-MDA, is a psychedelic drug of the amphetamine family.{{cite book | author1 = Alexander T. Shulgin | author2 = Ann Shulgin | chapter = #134 MMDA-3a 2-METHOXY-3,4-METHYLENEDIOXYAMPHETAMINE | pages = 795–798 | chapter-url = https://erowid.org/library/books_online/pihkal/pihkal134.shtml | title = PiHKAL: A Chemical Love Story | date = 1991 | publisher = Transform Press | edition = 1st | location = Berkeley, CA | isbn = 978-0-9630096-0-9 | oclc = 25627628 | url = https://books.google.com/books?id=O8AdHBGybpcC }}{{cite book | vauthors = Shulgin A, Manning T, Daley PF | chapter = #99. MMDA-3a | pages = 240–241 | chapter-url = https://archive.org/details/shulgin-index-vol-1/page/240/mode/1up | title = The Shulgin Index, Volume One: Psychedelic Phenethylamines and Related Compounds | publisher = Transform Press | location = Berkeley, CA | volume = 1 | year = 2011 | isbn = 978-0-9630096-3-0 | oclc = 709667010 }} It is the 2-methoxy derivative of 3,4-methylenedioxyamphetamine (MDA). The drug produces hallucinogenic effects in humans. Its dosage is listed as 20 to 80{{nbsp}}mg and its duration as 10 to 16{{nbsp}}hours in PiHKAL. A higher dose of 100{{nbsp}}mg was also reportedly explored and doses of 80 to 100{{nbsp}}mg were said to be very similar to 100{{nbsp}}μg LSD. MMDA-3a is a positional isomer of MMDA and hence is a Schedule I controlled substance in the United States.