Metaglycodol

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 2-(3-Chlorophenyl)-3-methyl-2,3-butanediol

| image = Metaglicodol.svg

| image_class = skin-invert-image

| CAS_number = 13980-94-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = F72B92ZZ08

| ATC_prefix = None

| ATC_suffix =

| PubChem = 26369

| DrugBank =

| ChemSpiderID = 24567

| chemical_formula =

| C=11 | H=15 | Cl=1 | O=2

| SMILES = CC(C)(C(C)(c1cccc(c1)Cl)O)O

| StdInChI = 1S/C11H15ClO2/c1-10(2,13)11(3,14)8-5-4-6-9(12)7-8/h4-7,13-14H,1-3H3

| StdInChIKey = OLXAYPPTCHXQRE-UHFFFAOYSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

}}

Metaglycodol (INN) is a drug described as a tranquilizer which was never marketed.{{cite book|author=World Health Organization|title=International Nonproprietary Names (INN) for Pharmaceutical Substances|url=https://books.google.com/books?id=HcogPwAACAAJ|year=2000|publisher=World Health Organization|isbn=978-0-11-986227-0}}{{cite book| vauthors = Ganellin CR, Triggle DJ |title=Dictionary of Pharmacological Agents|url=https://books.google.com/books?id=Z_mfTTIApVEC&pg=PA623|date=21 November 1996|publisher=CRC Press|isbn=978-0-412-46630-4|pages=623–}}{{cite journal | vauthors = Weaver LC, Newberne JW, Kerley TL | title = Some pharmacologic and toxicologic properties of metaglycodol | journal = Toxicology and Applied Pharmacology | volume = 3 | issue = 3 | pages = 335–46 | date = May 1961 | pmid = 13783546 | doi = 10.1016/0041-008X(61)90070-9 | doi-access = free }}

See also

References