Methoxpropamine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| verifiedrevid =

| IUPAC_name = 2-(3-Methoxyphenyl)-2-(propylamino)cyclohexanone

| image = Methoxpropamine.svg

| image_class = skin-invert-image

| width = 180

| tradename =

| legal_CA = Schedule I

| legal_UK = Class B

| legal_DE = NpSG

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 2504100-71-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = LTF83AU3X8

| CAS_supplemental =

| ATC_prefix =

| PubChem = 155817932

| ChemSpiderID =

| C=16 | H=23 | N=1 | O=2

| smiles = COc1cccc(c1)C2(NCCC)CCCCC2=O

| StdInChI = 1S/C16H23NO2/c1-3-11-17-16(10-5-4-9-15(16)18)13-7-6-8-14(12-13)19-2/h6-8,12,17H,3-5,9-11H2,1-2H3

| StdInChIKey = AAVOSBAXDRASAH-UHFFFAOYSA-N

}}

Methoxpropamine (MXPr, 2-Oxo-3'-methoxy-PCPr) is a dissociative anesthetic drug of the arylcyclohexylamine class and NMDA receptor antagonist{{cite journal | vauthors = Irie T, Yamazaki D, Kikura-Hanajiri R | title = A potential of methoxpropamine to be a widespread recreational drug: it blocks NMDA receptors and inhibits NMDA receptor-mediated synaptic transmission in a brain preparation of mice. | journal = Forensic Toxicology | date = July 2021 | volume = 39 | issue = 2 | pages = 474–80 | doi = 10.1007/s11419-021-00571-0 | s2cid = 232273277 }} that is closely related to substances such as methoxetamine and PCPr.{{cite journal | vauthors = Goncalves R, Castaing N, Richeval C, Ducint D, Titier K, Morvan E, Grélard A, Loquet A, Molimard M | display-authors = 6 | title = Methoxpropamine (MXPr) in powder, urine and hair samples: Analytical characterization and metabolite identification of a new threat | journal = Forensic Science International | volume = 333 | pages = 111215 | date = April 2022 | pmid = 35151938 | doi = 10.1016/j.forsciint.2022.111215 | s2cid = 246685658 | doi-access = free }} It has been sold online as a designer drug, first being identified in Denmark in October 2019,{{cite web | url = https://www.aekwien.at/documents/263869/449604/200629_EU+EARLY+WARNING+SYSTEM+SITUATION+REPORT+June.pdf | title = EU Early Warning System Situation Report. Situation report 1 | date = June 2020 | work = European Monitoring Centre for Drugs and Drug Addiction (EMCDDA) }} and is illegal in Finland.{{cite web | url = https://finlex.fi/fi/lainsaadanto/2014/1130 | title = Valtioneuvoston asetus kuluttajamarkkinoilta kielletyistä psykoaktiivisista aineista | trans-title = Government decree on psychoactive substances banned from the consumer market | work = Finlex Data Bank | publisher = Finnish Ministry of Justice | language = fi }}