Momordenol
{{Chembox
| ImageFile = Momordenol.svg
| ImageSize = 200px
| IUPACName = 3β-Hydroxystigmasta-5,14-dien-16-one
| SystematicName = (1R,3bR,7S,9aR,9bS,11aR)-1-[(2R,5R)-5-Ethyl-6-methylheptan-2-yl]-7-hydroxy-9a,11a-dimethyl-1,3b,4,6,7,8,9,9a,9b,10,11,11a-dodecahydro-2H-cyclopenta[a]phenanthren-2-one
| OtherNames =
| Section1 = {{Chembox Identifiers
| CASNo = 189156-41-0
| CASNo_Ref = {{Cascite|correct|CAS}}
| ChemSpiderID = 103884462
| PubChem = 102066428
| SMILES = CC[C@H](CC[C@@H](C)[C@H]1C(=O)C=C2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)C)C(C)C
| StdInChI=1S/C29H46O2/c1-7-20(18(2)3)9-8-19(4)27-26(31)17-25-23-11-10-21-16-22(30)12-14-28(21,5)24(23)13-15-29(25,27)6/h10,17-20,22-24,27,30H,7-9,11-16H2,1-6H3/t19-,20-,22+,23-,24+,27+,28+,29+/m1/s1
| StdInChIKey = MEWYFWRPPPAWSI-BDZSUDIQSA-N
}}
| Section2 = {{Chembox Properties
| C=29|H=46|O=2
| Appearance =
| Density =
| MeltingPtC = 160
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Momordenol (3β-hydroxy-stigmasta-5,14-dien-16-one) is a natural chemical compound, a sterol found in the fresh fruit of the bitter melon (Momordica charantia).{{cite journal | doi = 10.1016/S0031-9422(96)00615-2 | title = Triterpenes, A sterol and a monocyclic alcohol from Momordica charantia | journal = Phytochemistry | volume = 44 | issue = 7 | pages = 1313–1320 | year = 1997 | last1 = Begum | first1 = Sabira | last2 = Ahmed | first2 = Mansoor | last3 = Siddiqui | first3 = Bina S. | last4 = Khan | first4 = Abdullah | last5 = Saify | first5 = Zafar S. | last6 = Arif | first6 = Mohammed | bibcode = 1997PChem..44.1313B }}
The compound is soluble in ethyl acetate and methanol but not in pure chloroform or petrol. It crystallizes as fine needles that melt at 160–161 °C. It was isolated in 1997 by S. Begum and others.