Momordicilin

{{Chembox

| ImageFile = Momordicilin.svg

| ImageSize = 200px

| IUPACName = (4β)-23-[[(2E)-1-Hydroxy-1-methyl-2-penten-1-yl]oxy]-ursan-3-one

| OtherNames =

| Section1 = {{Chembox Identifiers

| CASNo = 189156-40-9

| CASNo_Ref = {{Cascite|correct|CAS}}

| ChemSpiderID = 103882698

| PubChem = 102066427

| StdInChI=1S/C36H60O3/c1-10-11-17-36(9,38)39-23-33(6)27-15-20-35(8)28(32(27,5)19-16-29(33)37)13-12-26-30-25(3)24(2)14-18-31(30,4)21-22-34(26,35)7/h11,17,24-28,30,38H,10,12-16,18-23H2,1-9H3/b17-11+/t24-,25+,26-,27-,28-,30+,31-,32+,33-,34-,35-,36?/m1/s1

| StdInChIKey = UQBFECUQCTWGFC-RQSRHSMUSA-N

| SMILES = CC/C=C/C(C)(O)OC[C@@]1([C@@H]2CC[C@@]3([C@@H]([C@]2(CCC1=O)C)CC[C@H]4[C@]3(CC[C@@]5([C@H]4[C@H]([C@@H](CC5)C)C)C)C)C)C

}}

| Section2 = {{Chembox Properties

| C=36|H=60|O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Momordicilin or 24-[1′-hydroxy,1′-methyl-2′-pentenyloxyl]-ursan-3-one is a chemical compound, a triterpenoid with formula {{chem|C|36|H|60|O|3}}, found in the fresh fruit of the bitter melon (Momordica charantia).Sabira Begum, Mansour Ahmed, Bina S. Siddiqui, Abdullah Khan, Zafar S. Saify, and Mohammed Arif (1997), Triterpenes, a sterol and a monocyclic alcohol from Momordica charantia. Phytochemistry, volume 44, issue 7, pages 1313-1320

The compound is soluble in ethyl acetate and chloroform but not in petrol. It crystallizes as needles that melt at 170−171 °C. It was isolated in 1997 by S. Begum and others.