Moracizine

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Drugbox

| IUPAC_name = ethyl [10-(3-morpholin-4-ylpropanoyl)-10H-phenothiazin-2-yl]carbamate

| image = Moricizin.svg

| USAN = Moricizine

| tradename = Ethmozine

| Drugs.com = {{drugs.com|CDI|moricizine}}

| MedlinePlus = a601214

| pregnancy_category = B (U.S.)

| legal_status =

| routes_of_administration =

| bioavailability = 34–38%

| protein_bound = 95%

| metabolism =

| elimination_half-life = 3–4 hours (healthy volunteers), 6–13 hours (cardiac disease)

| IUPHAR_ligand = 7244

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 31883-05-3

| ATC_prefix = C01

| ATC_suffix = BG01

| ATC_supplemental =

| PubChem = 34633

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00680

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 31872

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2GT1D0TMX1

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D05077

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 6997

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1075

| C=22 | H=25 | N=3 | O=4 | S=1

| smiles = O=C(OCC)Nc2cc1N(c3c(Sc1cc2)cccc3)C(=O)CCN4CCOCC4

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C22H25N3O4S/c1-2-29-22(27)23-16-7-8-20-18(15-16)25(17-5-3-4-6-19(17)30-20)21(26)9-10-24-11-13-28-14-12-24/h3-8,15H,2,9-14H2,1H3,(H,23,27)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = FUBVWMNBEHXPSU-UHFFFAOYSA-N

}}

Moracizine{{cite web|url=https://www.who.int/medicines/services/inn/StemBook2009.pdf|title=The use of stems in the selection of International Nonproprietary Names (INN) for pharmaceutical substances|year=2009|publisher=World Health Organization|page=103}} or moricizine, sold under the trade name Ethmozine, is an antiarrhythmic of class IC.{{cite journal | vauthors = Ahmmed GU, Hisatome I, Kurata Y, Makita N, Tanaka Y, Tanaka H, Okamura T, Sonoyama K, Furuse Y, Kato M, Yamamoto Y, Ogura K, Shimoyama M, Miake J, Sasaki N, Ogino K, Igawa O, Yoshida A, Shigemasa C | title = Analysis of moricizine block of sodium current in isolated guinea-pig atrial myocytes. Atrioventricular difference of moricizine block | journal = Vascular Pharmacology | volume = 38 | issue = 3 | pages = 131–41 | date = March 2002 | pmid = 12402511 | doi = 10.1016/S1537-1891(02)00213-6 }} It was used for the prophylaxis and treatment of serious and life-threatening ventricular arrhythmias,{{cite book|title=British National Formulary|edition=59th|publisher=British Medical Journal Publishing Group, Pharmaceutical Press|year=2010|title-link=British National Formulary}} but was withdrawn in 2007 for commercial reasons.{{cite news|url=http://www.hrsonline.org/policy/devicesdrugsfda/drugs/ethmozine_discontinued.cfm|title=Shire Announces Ethmozine will be Available until December 31, 2007|publisher=Heart Rhythm Society|access-date=January 12, 2012|archive-url=https://web.archive.org/web/20111210094917/http://www.hrsonline.org/Policy/DevicesDrugsFDA/Drugs/Ethmozine_discontinued.cfm|archive-date=December 10, 2011|url-status=dead}}