Mosher's acid

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 428793132

| Name = Mosher's acid

| ImageFileR1 = (R)-Mosher Acid Formula V.1.svg

| ImageName =

| ImageFileL1 = (S)-Mosher Acid Formula V.1.svg

| ImageFileR2 = R-Mosher's-acid-3D-balls.png

| ImageFileL2 = S-Mosher's-acid-3D-balls.png

| IUPACName =(R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid

(S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoic acid

| OtherNames = Methoxy(trifluoromethyl)phenylacetic acid, MTPA

|Section1={{Chembox Identifiers

| SMILES = COC(C(O)=O)(c1ccccc1)C(F)(F)F

| CASNo1_Ref = {{cascite|correct|CAS}}

| CASNo1 = 81655-41-6

| index1_label = (racemic)

| CASNo2_Ref = {{cascite|correct|PubChem}}

| CASNo2 = 20445-31-2

| index2_label = (R)

| CASNo3_Ref = {{cascite|correct|PubChem}}

| CASNo3 = 17257-71-5

| index3_label = (S)

| PubChem2 = 2723917

| PubChem3 = 6992788

| EC_number2 = 243-829-5

| EC_number3 = 241-292-1

| UNII1_Ref = {{fdacite|correct|FDA}}

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII3_Ref = {{fdacite|correct|FDA}}

| UNII3 = 172HCJ1IQV

| UNII2 = 27O5L9T1WM

| UNII1 = E015GCC0MA

| DTXSID = DTXSID90897007

| RTECS =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 78043

| InChI = 1/C10H9F3O3/c1-16-9(8(14)15,10(11,12)13)7-5-3-2-4-6-7/h2-6H,1H3,(H,14,15)

| InChIKey = JJYKJUXBWFATTE-UHFFFAOYAJ

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C10H9F3O3/c1-16-9(8(14)15,10(11,12)13)7-5-3-2-4-6-7/h2-6H,1H3,(H,14,15)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = JJYKJUXBWFATTE-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| Formula = C₁₀H₉F₃O₃

| MolarMass = 234.17

| Appearance = solid

| Density =

| Solubility =

| MeltingPtC = 46 to 49

| MeltingPt_notes =

| BoilingPtC = 105 to 107

| BoilingPt_notes = at 1 torr

| pKa =

| pKb =

| Viscosity =

}}

|Section3={{Chembox Structure

| Dipole =

}}

|Section7={{Chembox Hazards

| ExternalSDS =

| MainHazards =

| FlashPtC = 110

| GHSPictograms = {{GHS07}}

| GHSSignalWord = Warning

| HPhrases = {{H-phrases|315|319|335}}

| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}}

}}

|Section8={{Chembox Related

| OtherFunction_label = acyl chloride

| OtherFunction = Mosher's acid chloride

| OtherCompounds =

}}

}}

Mosher's acid, or α-methoxy-α-trifluoromethylphenylacetic acid (MTPA) is a carboxylic acid which was first used by Harry Stone Mosher as a chiral derivatizing agent.{{cite journal

|author1=J. A. Dale |author2=D. L. Dull |author3=H. S. Mosher | title = α-Methoxy-α-trifluoromethylphenylacetic acid, a versatile reagent for the determination of enantiomeric composition of alcohols and amines

| journal = Journal of Organic Chemistry

| year = 1969

| volume = 34

| issue = 9

| pages = 2543–2549

| doi = 10.1021/jo01261a013

}}{{cite journal

|author1=J. A. Dale |author2=H. S. Mosher | title = Nuclear magnetic resonance enantiomer regents. Configurational correlations via nuclear magnetic resonance chemical shifts of diastereomeric mandelate, O-methylmandelate, and α-methoxy-α-trifluoromethylphenylacetate (MTPA) esters

| journal = Journal of the American Chemical Society

| year = 1973

| volume = 95

| issue = 2

| pages = 512–519

| doi = 10.1021/ja00783a034

|bibcode=1973JAChS..95..512D }}{{cite journal

|author1=Y. Goldberg |author2=H. Alper | title = A new and simple synthesis of Mosher's acid

| journal = Journal of Organic Chemistry

| year = 1992

| volume = 57

| issue = 13

| pages = 3731–3732

| doi = 10.1021/jo00039a043

}}{{cite journal

|author1=D. L. Dull |author2=H. S. Mosher | title = Aberrant rotatory dispersion curves of α-hydroxy- and α-methoxy-α-trifluoromethylphenylacetic acids

| journal = Journal of the American Chemical Society

| year = 1967

| volume = 89

| issue = 16

| pages = 4230

| doi = 10.1021/ja00992a053

|bibcode=1967JAChS..89.4230D }} It is a chiral molecule, consisting of R and S enantiomers.