Nitromersol

{{short description|Organomercury antiseptic and antifungal agent}}

{{Chembox

| ImageFile = Nitromersol.svg

| ImageSize = 112px

| IUPACName = 5-Methyl-2-nitro-7-oxa-8-mercurabicyclo[4.2.0]octa-1(6),2,4-triene

| OtherNames = Metaphen; 6-Methyl-3-nitrobenzoxamercurete; 4-Nitro-5-hydroxymercuriorthocresol

| Section1 = {{Chembox Identifiers

| CASNo = 133-58-4

| CASNo_Ref = {{cascite|correct|}}

| UNII = RU6242GP15

| PubChem = 16682935

| ChemSpiderID = 16739372

| SMILES = Cc1ccc(c2[Hg]Oc12)[N+]([O-])=O

| InChI = 1/C7H6NO3.Hg/c1-5-2-3-6(8(10)11)4-7(5)9;/h2-3,9H,1H3;/q;+1/p-1/rC7H5HgNO3/c1-4-2-3-5(9(10)11)6-7(4)12-8-6/h2-3H,1H3

| InChIKey = UEHLXXJAWYWUGI-ITKDQSLKAT

| StdInChI = 1S/C7H6NO3.Hg/c1-5-2-3-6(8(10)11)4-7(5)9;/h2-3,9H,1H3;/q;+1/p-1

| StdInChIKey = UEHLXXJAWYWUGI-UHFFFAOYSA-M

}}

| Section2 = {{Chembox Properties

| C=7 | H=5 | Hg=1 | N=1 | O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards = moderately toxic

| FlashPt =

| AutoignitionPt =

}}

}}

Nitromersol (metaphen) is a mercury-containing organic compound that is primarily used as an antiseptic and disinfectant. It is a brown-yellow solid that has no odor or taste, does not irritate the skin or mucous membranes, and has no impact on rubber or metallic instruments, including surgical and dental tools.

This compound is a confirmed animal carcinogen. It can emit toxic fumes of NO_x and mercury vapor when heated. In 1998, use of nitromersol (and other mercury-containing products) as OTC first-aid antiseptics and products for diaper rash and vaginal contraceptives was disallowed by the FDA. Nitromersol can cause hypersensitivity reactions.

It is still in use as a preservative for vaccines and antitoxins.{{example needed|s|date=September 2021}}{{cn|date=February 2025}}