Norclostebol acetate

{{Short description|Synthetic, injectable anabolic-androgenic steroid}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = [(8R,9S,10R,13S,14S)-4-Chloro-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate

| image = Norclostebol acetate.svg

| width = 250

| tradename = Anabol 4-19

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Intramuscular injection

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 1164-99-4

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 101730066

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 91682

| UNII = JKP2S7674A

| KEGG =

| ChEBI =

| ChEMBL =

| C=20 | H=27 | Cl=1 | O=3

| SMILES = CC(=O)OC1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=C(C(=O)CC[C@H]34)Cl)C

| StdInChI_Ref =

| StdInChI = 1S/C20H27ClO3/c1-11(22)24-18-8-6-16-14-3-4-15-12(5-7-17(23)19(15)21)13(14)9-10-20(16,18)2/h12-14,16,18H,3-10H2,1-2H3/t12-,13-,14-,16+,18?,20+/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = FNMAFGQVNCRKGS-FOMDFYGASA-N

| synonyms =

}}

Norclostebol acetate (brand name Anabol 4-19), or norchlorotestosterone acetate (NClTA), also known as 4-chloro-19-nortestosterone 17β-acetate or as 4-chloroestr-4-en-17β-ol-3-one, is a synthetic, injectable anabolic-androgenic steroid (AAS) and derivative of 19-nortestosterone (nandrolone).{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=RA1-PA254|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|page=254}}{{cite book| vauthors = Lowinson JH |title=Substance Abuse: A Comprehensive Textbook|url=https://books.google.com/books?id=HtGb2wNsgn4C&pg=PA428|year=2005|publisher=Lippincott Williams & Wilkins|isbn=978-0-7817-3474-5|pages=428–}}{{cite book| vauthors = Vaamonde D, du Plessis SS, Agarwal A |title=Exercise and Human Reproduction: Induced Fertility Disorders and Possible Therapies|url=https://books.google.com/books?id=d86zCwAAQBAJ&pg=PA230|date=7 March 2016|publisher=Springer|isbn=978-1-4939-3402-7|pages=230–}}{{cite journal| vauthors = Van Hoof N, De Wasch K, Poelmans S, Bruneel D, Spruyt S, Noppe H, Janssen C, Courtheyn D, De Brab H|title=Norchlorotestosterone Acetate: An Alternative Metabolism Study and GC?MS2 Analysis in Kidney Fat, Urine, and Faeces|journal=Chromatographia|volume=59|issue=S1|year=2004|pages=S85–S93|issn=0009-5893|doi=10.1365/s10337-003-0178-4|s2cid=86146575}}{{cite journal | vauthors = Le Bizec B, Van Hoof N, Courtheyn D, Gaudin I, Van De Wiele M, Bichon E, De Brabander H, André F | display-authors = 6 | title = New anabolic steroid illegally used in cattle-structure elucidation of 19-norchlorotestosterone acetate metabolites in bovine urine | journal = The Journal of Steroid Biochemistry and Molecular Biology | volume = 98 | issue = 1 | pages = 78–89 | date = January 2006 | pmid = 16216493 | doi = 10.1016/j.jsbmb.2005.07.008 | s2cid = 24039237 }} It is an androgen ester – specifically, the C17β acetate ester of norclostebol (4-chloro-19-nortestosterone).