OSI-7904

{{Short description|Chemical compound}}

{{Infobox drug

| drug_name =

| INN =

| type =

| image = OSI-7904.svg

| alt =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_US =

| pregnancy_category=

| routes_of_administration =

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_DE =

| legal_NZ =

| legal_UK =

| legal_US =

| legal_UN =

| legal_status = Investigational

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| IUPAC_name = (2S)-2-[6-[(3-Methyl-1-oxo-2H-benzo[f]quinazolin-9-yl)methylamino]-3-oxo-1H-isoindol-2-yl]pentanedioic acid

| CAS_number = 139987-54-5

| PubChem = 135403832

| DrugBank =

| UNII = ON177ZCE7M

| C=27|H=24|N=4|O=6

| smiles = CC1=NC2=C(C3=C(C=CC(=C3)CNC4=CC5=C(C=C4)C(=O)N(C5)[C@@H](CCC(=O)O)C(=O)O)C=C2)C(=O)N1

}}

OSI-7904 is a noncompetitive liposomal thymidylate synthase inhibitor. OSI-7904 is a benzoquinazoline folate analog with antineoplastic activity. As a thymidylate synthase inhibitor, OSI-7904 noncompetitively binds to thymidylate synthase, resulting in inhibition of thymine nucleotide synthesis and DNA replication.{{cite web|url=http://www.cancer.gov/drugdictionary?cdrid=352016|publisher=National Cancer Institute|title=NCI Drug Dictionary: OSI-7904L}}

OSI-7904L is a liposome-encapsulated formulation of OSI-7904. Liposome encapsulation improves the efficacy and increases the half-life of OSI-7904.

Its effect on solid tumors is currently under evaluation.{{cite journal |vauthors=Ricart AD, Berlin JD, Papadopoulos KP, etal |title=Phase I, pharmacokinetic and biological correlative study of OSI-7904L, a novel liposomal thymidylate synthase inhibitor, and cisplatin in patients with solid tumors |journal=Clin. Cancer Res. |volume=14 |issue=23 |pages=7947–55 |date=December 2008 |pmid=19047127 |doi=10.1158/1078-0432.CCR-08-0864 |s2cid=14215154 |url=http://clincancerres.aacrjournals.org/content/clincanres/14/23/7947.full.pdf|doi-access=free }}{{cite web|url=http://www.asco.org/ASCOv2/Meetings/Abstracts?&vmview=abst_detail_view&confID=23&abstractID=101198|title=Phase I study of liposomal thymidylate synthase inhibitor (TSI) OSI-7904L in patients with advanced solid tumors. Proc Am Soc Clin Oncol 22: 2003 (abstr 561)}}{{cite journal|title=A phase I and pharmacokinetic study of OSI-7904L, a liposomal thymidylate synthase inhibitor in combination with oxaliplatin in patients with advanced colorectal cancer. Cancer Chemotherapy and Pharmacology April 2008, Volume 61, Issue 4, pp 579-585 | doi=10.1007/s00280-007-0509-5 |pmid = 17520255| volume=61|issue=4|journal=Cancer Chemotherapy and Pharmacology|pages=579–585|vauthors=Clamp AR|year = 2008| s2cid=26018991 }}